| General Information | |
|---|---|
| ZINC ID | ZINC000040955148 |
| Molecular Weight (Da) | 363 |
| SMILES | Fc1ccc(Nc2ccc(CN3CCO[C@@H](c4ccccc4)C3)cn2)cc1 |
| Molecular Formula | C22F1N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 104.817 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 4.35 |
| Activity (Ki) in nM | 34.674 |
| Polar Surface Area (PSA) | 37.39 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.96890622 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.41 |
| Xlogp3 | 3.82 |
| Wlogp | 4.1 |
| Mlogp | 3.26 |
| Silicos-it log p | 4 |
| Consensus log p | 3.72 |
| Esol log s | -4.66 |
| Esol solubility (mg/ml) | 7.89E-03 |
| Esol solubility (mol/l) | 2.17E-05 |
| Esol class | Moderately |
| Ali log s | -4.3 |
| Ali solubility (mg/ml) | 1.82E-02 |
| Ali solubility (mol/l) | 5.01E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -7.7 |
| Silicos-it solubility (mg/ml) | 7.23E-06 |
| Silicos-it solubility (mol/l) | 1.99E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.8 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.32 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.626 |
| Logd | 3.832 |
| Logp | 4.14 |
| F (20%) | 0.007 |
| F (30%) | 0.067 |
| Mdck | 1.84E-05 |
| Ppb | 0.9498 |
| Vdss | 3.034 |
| Fu | 0.0504 |
| Cyp1a2-inh | 0.452 |
| Cyp1a2-sub | 0.898 |
| Cyp2c19-inh | 0.827 |
| Cyp2c19-sub | 0.091 |
| Cl | 10.612 |
| T12 | 0.046 |
| H-ht | 0.962 |
| Dili | 0.9 |
| Roa | 0.877 |
| Fdamdd | 0.932 |
| Skinsen | 0.704 |
| Ec | 0.006 |
| Ei | 0.024 |
| Respiratory | 0.986 |
| Bcf | 2.263 |
| Igc50 | 4.521 |
| Lc50 | 6.064 |
| Lc50dm | 6.897 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.899 |
| Nr-aromatase | 0.947 |
| Nr-er | 0.259 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.553 |
| Sr-atad5 | 0.021 |
| Sr-hse | 0.501 |
| Sr-mmp | 0.606 |
| Sr-p53 | 0.107 |
| Vol | 378.962 |
| Dense | 0.958 |
| Flex | 25 |
| Nstereo | 0.16 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.762 |
| Fsp3 | 3.141 |
| Mce-18 | 0.227 |
| Natural product-likeness | 62.63 |
| Alarm nmr | -1.201 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |