| General Information | |
|---|---|
| ZINC ID | ZINC000040972483 |
| Molecular Weight (Da) | 528 |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CC2CCCC2)s1 |
| Molecular Formula | C27Cl2N4O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 137.565 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| LogP | 8.497 |
| Activity (Ki) in nM | 1819.701 |
| Polar Surface Area (PSA) | 78.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 2.495 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.41 |
| Ilogp | 5.2 |
| Xlogp3 | 8 |
| Wlogp | 6.59 |
| Mlogp | 5.58 |
| Silicos-it log p | 6.94 |
| Consensus log p | 6.46 |
| Esol log s | -8.16 |
| Esol solubility (mg/ml) | 0.00000366 |
| Esol solubility (mol/l) | 6.94E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.5 |
| Ali solubility (mg/ml) | 0.00000016 |
| Ali solubility (mol/l) | 3.17E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.09 |
| Silicos-it solubility (mg/ml) | 0.00000432 |
| Silicos-it solubility (mol/l) | 8.18E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.84 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.38 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.269 |
| Logd | 5.135 |
| Logp | 7.047 |
| F (20%) | 0.002 |
| F (30%) | 0.157 |
| Mdck | 5.29E-06 |
| Ppb | 1.014 |
| Vdss | 1.852 |
| Fu | 0.0098 |
| Cyp1a2-inh | 0.089 |
| Cyp1a2-sub | 0.824 |
| Cyp2c19-inh | 0.884 |
| Cyp2c19-sub | 0.761 |
| Cl | 4.798 |
| T12 | 0.003 |
| H-ht | 0.991 |
| Dili | 0.973 |
| Roa | 0.613 |
| Fdamdd | 0.215 |
| Skinsen | 0.3 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.41 |
| Bcf | 1.319 |
| Igc50 | 5.359 |
| Lc50 | 6.525 |
| Lc50dm | 6.237 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.55 |
| Nr-ahr | 0.973 |
| Nr-aromatase | 0.968 |
| Nr-er | 0.898 |
| Nr-er-lbd | 0.045 |
| Nr-ppar-gamma | 0.943 |
| Sr-are | 0.967 |
| Sr-atad5 | 0.736 |
| Sr-hse | 0.873 |
| Sr-mmp | 0.979 |
| Sr-p53 | 0.99 |
| Vol | 508.11 |
| Dense | 1.035 |
| Flex | 0.172 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 5 |
| Qed | 0.376 |
| Synth | 3.073 |
| Fsp3 | 0.407 |
| Mce-18 | 68.211 |
| Natural product-likeness | -0.917 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |