| General Information | |
|---|---|
| ZINC ID | ZINC000040973110 |
| Molecular Weight (Da) | 501 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c2cc(Sc3ccccc3)ccc21 |
| Molecular Formula | C31N2O2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 145.556 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| LogP | 7.371 |
| Activity (Ki) in nM | 3.388 |
| Polar Surface Area (PSA) | 76.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03282785 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.48 |
| Ilogp | 5.16 |
| Xlogp3 | 7.72 |
| Wlogp | 7.04 |
| Mlogp | 5.13 |
| Silicos-it log p | 6.58 |
| Consensus log p | 6.33 |
| Esol log s | -7.54 |
| Esol solubility (mg/ml) | 0.0000143 |
| Esol solubility (mol/l) | 2.87E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.17 |
| Ali solubility (mg/ml) | 0.00000034 |
| Ali solubility (mol/l) | 6.81E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.3 |
| Silicos-it solubility (mg/ml) | 0.00000024 |
| Silicos-it solubility (mol/l) | 4.98E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.87 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 4 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.924 |
| Logd | 5.115 |
| Logp | 6.818 |
| F (20%) | 0.006 |
| F (30%) | 0.353 |
| Mdck | 2.03E-05 |
| Ppb | 0.9754 |
| Vdss | 0.767 |
| Fu | 0.0109 |
| Cyp1a2-inh | 0.156 |
| Cyp1a2-sub | 0.173 |
| Cyp2c19-inh | 0.807 |
| Cyp2c19-sub | 0.077 |
| Cl | 2.187 |
| T12 | 0.003 |
| H-ht | 0.583 |
| Dili | 0.472 |
| Roa | 0.04 |
| Fdamdd | 0.696 |
| Skinsen | 0.045 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.81 |
| Bcf | 1.719 |
| Igc50 | 5.294 |
| Lc50 | 4.984 |
| Lc50dm | 6.523 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.74 |
| Nr-aromatase | 0.403 |
| Nr-er | 0.315 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.022 |
| Sr-are | 0.761 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.942 |
| Sr-mmp | 0.881 |
| Sr-p53 | 0.841 |
| Vol | 527.748 |
| Dense | 0.948 |
| Flex | 0.29 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.338 |
| Synth | 3.772 |
| Fsp3 | 0.484 |
| Mce-18 | 77.913 |
| Natural product-likeness | -1.092 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |