| General Information | |
|---|---|
| ZINC ID | ZINC000040974152 |
| Molecular Weight (Da) | 478 |
| SMILES | Cc1c(C2=NC(=S)C(C)(C)N2C)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C22Cl3N4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.776 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| LogP | 7.805 |
| Activity (Ki) in nM | 6.3096 |
| Polar Surface Area (PSA) | 65.51 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.98 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.14 |
| Xlogp3 | 6.45 |
| Wlogp | 5.84 |
| Mlogp | 5.43 |
| Silicos-it log p | 7.65 |
| Consensus log p | 5.9 |
| Esol log s | -7.09 |
| Esol solubility (mg/ml) | 0.0000391 |
| Esol solubility (mol/l) | 8.18E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.62 |
| Ali solubility (mg/ml) | 0.0000115 |
| Ali solubility (mol/l) | 0.00000002 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.97 |
| Silicos-it solubility (mg/ml) | 0.00000051 |
| Silicos-it solubility (mol/l) | 1.08E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.64 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.67 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.901 |
| Logd | 5.002 |
| Logp | 5.874 |
| F (20%) | 0.002 |
| F (30%) | 0.014 |
| Mdck | - |
| Ppb | 97.39% |
| Vdss | 0.869 |
| Fu | 2.26% |
| Cyp1a2-inh | 0.211 |
| Cyp1a2-sub | 0.939 |
| Cyp2c19-inh | 0.908 |
| Cyp2c19-sub | 0.923 |
| Cl | 5.624 |
| T12 | 0.069 |
| H-ht | 0.125 |
| Dili | 0.97 |
| Roa | 0.206 |
| Fdamdd | 0.76 |
| Skinsen | 0.024 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.377 |
| Bcf | 3.958 |
| Igc50 | 5.398 |
| Lc50 | 7.481 |
| Lc50dm | 5.919 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.016 |
| Nr-ahr | 0.612 |
| Nr-aromatase | 0.976 |
| Nr-er | 0.897 |
| Nr-er-lbd | 0.614 |
| Nr-ppar-gamma | 0.581 |
| Sr-are | 0.918 |
| Sr-atad5 | 0.032 |
| Sr-hse | 0.82 |
| Sr-mmp | 0.97 |
| Sr-p53 | 0.955 |
| Vol | 436.607 |
| Dense | 1.09 |
| Flex | 0.13 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.398 |
| Synth | 2.951 |
| Fsp3 | 0.227 |
| Mce-18 | 56 |
| Natural product-likeness | -1.025 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |