| General Information | |
|---|---|
| ZINC ID | ZINC000040975566 |
| Molecular Weight (Da) | 361 |
| SMILES | CCCCCN1C(=O)/C(=NNC(=O)OC(C)(C)C)c2ccc(OC)cc21 |
| Molecular Formula | C19N3O4 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 98.804 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| LogP | 3.971 |
| Activity (Ki) in nM | 15.849 |
| Polar Surface Area (PSA) | 80.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.63606619 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.53 |
| Ilogp | 3.42 |
| Xlogp3 | 4.39 |
| Wlogp | 3.08 |
| Mlogp | 2.04 |
| Silicos-it log p | 3.18 |
| Consensus log p | 3.22 |
| Esol log s | -4.42 |
| Esol solubility (mg/ml) | 1.36E-02 |
| Esol solubility (mol/l) | 3.77E-05 |
| Esol class | Moderately |
| Ali log s | -5.79 |
| Ali solubility (mg/ml) | 5.84E-04 |
| Ali solubility (mol/l) | 1.62E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -5.25 |
| Silicos-it solubility (mg/ml) | 2.06E-03 |
| Silicos-it solubility (mol/l) | 5.69E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.39 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 1 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.47 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.724 |
| Logd | 4.199 |
| Logp | 5.218 |
| F (20%) | 0.018 |
| F (30%) | 0.957 |
| Mdck | 2.07E-05 |
| Ppb | 1.0037 |
| Vdss | 1.4 |
| Fu | 0.0219 |
| Cyp1a2-inh | 0.55 |
| Cyp1a2-sub | 0.91 |
| Cyp2c19-inh | 0.783 |
| Cyp2c19-sub | 0.883 |
| Cl | 4.031 |
| T12 | 0.176 |
| H-ht | 0.627 |
| Dili | 0.508 |
| Roa | 0.63 |
| Fdamdd | 0.903 |
| Skinsen | 0.124 |
| Ec | 0.003 |
| Ei | 0.027 |
| Respiratory | 0.84 |
| Bcf | 1.003 |
| Igc50 | 4.318 |
| Lc50 | 5.347 |
| Lc50dm | 4.5 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.986 |
| Nr-aromatase | 0.013 |
| Nr-er | 0.839 |
| Nr-er-lbd | 0.668 |
| Nr-ppar-gamma | 0.048 |
| Sr-are | 0.792 |
| Sr-atad5 | 0.265 |
| Sr-hse | 0.063 |
| Sr-mmp | 0.727 |
| Sr-p53 | 0.245 |
| Vol | 372.4 |
| Dense | 0.97 |
| Flex | 12 |
| Nstereo | 0.75 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 3 |
| Synth | 0.539 |
| Fsp3 | 2.801 |
| Mce-18 | 0.526 |
| Natural product-likeness | 16 |
| Alarm nmr | -0.569 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |