| General Information | |
|---|---|
| ZINC ID | ZINC000040976405 |
| Molecular Weight (Da) | 374 |
| SMILES | CC(C)(C)[C@H](NC(=O)n1c(=O)n(C[C@H]2CCCO2)c2ccccc21)C(N)=O |
| Molecular Formula | C19N4O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.413 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 3.3 |
| Activity (Ki) in nM | 6.026 |
| Polar Surface Area (PSA) | 108.35 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.65421724 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.53 |
| Ilogp | 3.12 |
| Xlogp3 | 2.2 |
| Wlogp | 1.44 |
| Mlogp | 1.77 |
| Silicos-it log p | 0.9 |
| Consensus log p | 1.88 |
| Esol log s | -3.33 |
| Esol solubility (mg/ml) | 0.174 |
| Esol solubility (mol/l) | 0.000465 |
| Esol class | Soluble |
| Ali log s | -4.11 |
| Ali solubility (mg/ml) | 0.0291 |
| Ali solubility (mol/l) | 0.0000777 |
| Ali class | Moderately |
| Silicos-it logsw | -2.98 |
| Silicos-it solubility (mg/ml) | 0.389 |
| Silicos-it solubility (mol/l) | 0.00104 |
| Silicos-it class | Soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.02 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.64 |
| Logd | 2.507 |
| Logp | 2.485 |
| F (20%) | 0.027 |
| F (30%) | 0.012 |
| Mdck | 3.18E-05 |
| Ppb | 0.6053 |
| Vdss | 0.655 |
| Fu | 0.3688 |
| Cyp1a2-inh | 0.015 |
| Cyp1a2-sub | 0.12 |
| Cyp2c19-inh | 0.074 |
| Cyp2c19-sub | 0.589 |
| Cl | 3.607 |
| T12 | 0.603 |
| H-ht | 0.766 |
| Dili | 0.725 |
| Roa | 0.038 |
| Fdamdd | 0.9 |
| Skinsen | 0.099 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.357 |
| Bcf | 0.828 |
| Igc50 | 2.946 |
| Lc50 | 4.658 |
| Lc50dm | 4.239 |
| Nr-ar | 0.014 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.496 |
| Nr-aromatase | 0.023 |
| Nr-er | 0.229 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.068 |
| Sr-are | 0.258 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.134 |
| Sr-mmp | 0.462 |
| Sr-p53 | 0.409 |
| Vol | 374.84 |
| Dense | 0.998 |
| Flex | 0.389 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.844 |
| Synth | 3.32 |
| Fsp3 | 0.526 |
| Mce-18 | 68.793 |
| Natural product-likeness | -0.413 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |