| General Information | |
|---|---|
| ZINC ID | ZINC000042876994 |
| Molecular Weight (Da) | 554 |
| SMILES | O=C(NC1CCCCCC1)c1cnn(-c2ccc(Cl)cc2Cl)c1-c1ccc(I)cc1 |
| Molecular Formula | C23Cl2I1N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.769 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 6.962 |
| Activity (Ki) in nM | 1096.48 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13116908 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.33 |
| Xlogp3 | 7.09 |
| Wlogp | 6.9 |
| Mlogp | 5.5 |
| Silicos-it log p | 6.22 |
| Consensus log p | 6.01 |
| Esol log s | -7.83 |
| Esol solubility (mg/ml) | 0.00000815 |
| Esol solubility (mol/l) | 1.47E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.89 |
| Ali solubility (mg/ml) | 0.00000708 |
| Ali solubility (mol/l) | 1.28E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.1 |
| Silicos-it solubility (mg/ml) | 0.00000044 |
| Silicos-it solubility (mol/l) | 7.98E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.65 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.27 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.167 |
| Logd | 3.838 |
| Logp | 6.838 |
| F (20%) | 0.001 |
| F (30%) | 0.014 |
| Mdck | - |
| Ppb | 99.71% |
| Vdss | 1.805 |
| Fu | 1.24% |
| Cyp1a2-inh | 0.334 |
| Cyp1a2-sub | 0.176 |
| Cyp2c19-inh | 0.812 |
| Cyp2c19-sub | 0.096 |
| Cl | 2.149 |
| T12 | 0.011 |
| H-ht | 0.389 |
| Dili | 0.952 |
| Roa | 0.408 |
| Fdamdd | 0.512 |
| Skinsen | 0.129 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.132 |
| Bcf | 2.983 |
| Igc50 | 5.456 |
| Lc50 | 6.303 |
| Lc50dm | 6.168 |
| Nr-ar | 0.02 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.658 |
| Nr-aromatase | 0.93 |
| Nr-er | 0.652 |
| Nr-er-lbd | 0.043 |
| Nr-ppar-gamma | 0.902 |
| Sr-are | 0.91 |
| Sr-atad5 | 0.289 |
| Sr-hse | 0.709 |
| Sr-mmp | 0.944 |
| Sr-p53 | 0.916 |
| Vol | 445.89 |
| Dense | 1.24 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.282 |
| Synth | 2.371 |
| Fsp3 | 0.304 |
| Mce-18 | 54.267 |
| Natural product-likeness | -1.685 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |