| General Information | |
|---|---|
| ZINC ID | ZINC000042878488 |
| Molecular Weight (Da) | 498 |
| SMILES | CC(C)(C)c1nnc(-c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2C(F)F)o1 |
| Molecular Formula | C22Cl3F2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.468 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 7.509 |
| Activity (Ki) in nM | 36.3078 |
| Polar Surface Area (PSA) | 56.74 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.89 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.19 |
| Xlogp3 | 7.29 |
| Wlogp | 8.3 |
| Mlogp | 5.58 |
| Silicos-it log p | 6.97 |
| Consensus log p | 6.47 |
| Esol log s | -7.7 |
| Esol solubility (mg/ml) | 0.00000999 |
| Esol solubility (mol/l) | 2.01E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.31 |
| Ali solubility (mg/ml) | 0.00000245 |
| Ali solubility (mol/l) | 4.93E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.92 |
| Silicos-it solubility (mg/ml) | 5.98E-08 |
| Silicos-it solubility (mol/l) | 1.20E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.16 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.75 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.168 |
| Logd | 5.185 |
| Logp | 6.331 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 99.95% |
| Vdss | 5.425 |
| Fu | 1.64% |
| Cyp1a2-inh | 0.203 |
| Cyp1a2-sub | 0.802 |
| Cyp2c19-inh | 0.814 |
| Cyp2c19-sub | 0.093 |
| Cl | 3.369 |
| T12 | 0.01 |
| H-ht | 0.329 |
| Dili | 0.984 |
| Roa | 0.129 |
| Fdamdd | 0.438 |
| Skinsen | 0.048 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.615 |
| Bcf | 3.379 |
| Igc50 | 5.16 |
| Lc50 | 6.779 |
| Lc50dm | 5.917 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.09 |
| Nr-ahr | 0.133 |
| Nr-aromatase | 0.984 |
| Nr-er | 0.141 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.334 |
| Sr-are | 0.918 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.951 |
| Sr-p53 | 0.759 |
| Vol | 439.023 |
| Dense | 1.13 |
| Flex | 0.227 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.289 |
| Synth | 2.827 |
| Fsp3 | 0.227 |
| Mce-18 | 27 |
| Natural product-likeness | -1.419 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |