| General Information | |
|---|---|
| ZINC ID | ZINC000042878985 |
| Molecular Weight (Da) | 528 |
| SMILES | CC(C)(C)c1nnc(-c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2Cn2cccn2)o1 |
| Molecular Formula | C25Cl3N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.057 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| LogP | 6.824 |
| Activity (Ki) in nM | 20.4174 |
| Polar Surface Area (PSA) | 74.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.048 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 27 |
| Fraction csp3 | 0.2 |
| Ilogp | 4.16 |
| Xlogp3 | 6.58 |
| Wlogp | 7.09 |
| Mlogp | 5.01 |
| Silicos-it log p | 5.87 |
| Consensus log p | 5.74 |
| Esol log s | -7.43 |
| Esol solubility (mg/ml) | 0.0000195 |
| Esol solubility (mol/l) | 3.69E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.95 |
| Ali solubility (mg/ml) | 0.00000599 |
| Ali solubility (mol/l) | 1.13E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.21 |
| Silicos-it solubility (mg/ml) | 3.24E-08 |
| Silicos-it solubility (mol/l) | 6.14E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.85 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.303 |
| Logd | 5.179 |
| Logp | 5.833 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 98.29% |
| Vdss | 3.312 |
| Fu | 2.32% |
| Cyp1a2-inh | 0.196 |
| Cyp1a2-sub | 0.515 |
| Cyp2c19-inh | 0.87 |
| Cyp2c19-sub | 0.075 |
| Cl | 4.703 |
| T12 | 0.013 |
| H-ht | 0.202 |
| Dili | 0.99 |
| Roa | 0.397 |
| Fdamdd | 0.212 |
| Skinsen | 0.036 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.539 |
| Bcf | 2.592 |
| Igc50 | 4.837 |
| Lc50 | 6.506 |
| Lc50dm | 4.708 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.227 |
| Nr-ahr | 0.419 |
| Nr-aromatase | 0.993 |
| Nr-er | 0.897 |
| Nr-er-lbd | 0.632 |
| Nr-ppar-gamma | 0.72 |
| Sr-are | 0.935 |
| Sr-atad5 | 0.018 |
| Sr-hse | 0.028 |
| Sr-mmp | 0.944 |
| Sr-p53 | 0.846 |
| Vol | 486.94 |
| Dense | 1.08 |
| Flex | 0.222 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.244 |
| Synth | 2.834 |
| Fsp3 | 0.2 |
| Mce-18 | 30 |
| Natural product-likeness | -1.793 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |