| General Information | |
|---|---|
| ZINC ID | ZINC000042887636 |
| Molecular Weight (Da) | 604 |
| SMILES | O=C([C@@H]1C[C@H]1c1ccc(C(F)(F)F)cc1)N1CCN(S(=O)(=O)c2cc([C@@H](O)C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| Molecular Formula | C24F9N2O4S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.257 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| LogP | 4.522 |
| Activity (Ki) in nM | 1.5136 |
| Polar Surface Area (PSA) | 86.3 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.975 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.46 |
| Ilogp | 3.58 |
| Xlogp3 | 4.22 |
| Wlogp | 8.52 |
| Mlogp | 3.66 |
| Silicos-it log p | 4.71 |
| Consensus log p | 4.94 |
| Esol log s | -5.87 |
| Esol solubility (mg/ml) | 0.000807 |
| Esol solubility (mol/l) | 0.00000134 |
| Esol class | Moderately |
| Ali log s | -5.74 |
| Ali solubility (mg/ml) | 0.00109 |
| Ali solubility (mol/l) | 0.00000181 |
| Ali class | Moderately |
| Silicos-it logsw | -6.76 |
| Silicos-it solubility (mg/ml) | 0.000104 |
| Silicos-it solubility (mol/l) | 0.00000017 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.99 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.46 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.955 |
| Logd | 4.07 |
| Logp | 4.468 |
| F (20%) | 0.003 |
| F (30%) | 0.009 |
| Mdck | - |
| Ppb | 98.70% |
| Vdss | 1.931 |
| Fu | 0.79% |
| Cyp1a2-inh | 0.079 |
| Cyp1a2-sub | 0.473 |
| Cyp2c19-inh | 0.712 |
| Cyp2c19-sub | 0.85 |
| Cl | 3.04 |
| T12 | 0.004 |
| H-ht | 0.995 |
| Dili | 0.977 |
| Roa | 0.189 |
| Fdamdd | 0.952 |
| Skinsen | 0.01 |
| Ec | 0.003 |
| Ei | 0.005 |
| Respiratory | 0.879 |
| Bcf | 1.306 |
| Igc50 | 3.976 |
| Lc50 | 5.921 |
| Lc50dm | 7.197 |
| Nr-ar | 0.154 |
| Nr-ar-lbd | 0.031 |
| Nr-ahr | 0.168 |
| Nr-aromatase | 0.608 |
| Nr-er | 0.312 |
| Nr-er-lbd | 0.024 |
| Nr-ppar-gamma | 0.275 |
| Sr-are | 0.831 |
| Sr-atad5 | 0.001 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.694 |
| Sr-p53 | 0.517 |
| Vol | 501.251 |
| Dense | 1.205 |
| Flex | 0.375 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.49 |
| Synth | 3.746 |
| Fsp3 | 0.458 |
| Mce-18 | 119 |
| Natural product-likeness | -1.133 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |