| General Information | |
|---|---|
| ZINC ID | ZINC000042889401 |
| Molecular Weight (Da) | 568 |
| SMILES | Cc1c(C(=O)NN2C[C@H]3CCC[C@H]3C2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CC2CCCCC2)s1 |
| Molecular Formula | C30Cl2N4O1S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 149.307 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| LogP | 9.22 |
| Activity (Ki) in nM | 1737.801 |
| Polar Surface Area (PSA) | 78.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.171 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.47 |
| Ilogp | 5.25 |
| Xlogp3 | 9.01 |
| Wlogp | 7.22 |
| Mlogp | 6.15 |
| Silicos-it log p | 7.23 |
| Consensus log p | 6.97 |
| Esol log s | -9.02 |
| Esol solubility (mg/ml) | 0.00000054 |
| Esol solubility (mol/l) | 9.62E-10 |
| Esol class | Poorly sol |
| Ali log s | -10.55 |
| Ali solubility (mg/ml) | 1.61E-08 |
| Ali solubility (mol/l) | 2.84E-11 |
| Ali class | Insoluble |
| Silicos-it logsw | -8.41 |
| Silicos-it solubility (mg/ml) | 0.00000222 |
| Silicos-it solubility (mol/l) | 3.92E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.37 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.36 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.496 |
| Logd | 5.606 |
| Logp | 7.889 |
| F (20%) | 0.006 |
| F (30%) | 0.114 |
| Mdck | 5.71E-06 |
| Ppb | 1.0236 |
| Vdss | 2.717 |
| Fu | 0.0066 |
| Cyp1a2-inh | 0.089 |
| Cyp1a2-sub | 0.844 |
| Cyp2c19-inh | 0.884 |
| Cyp2c19-sub | 0.866 |
| Cl | 4.509 |
| T12 | 0.002 |
| H-ht | 0.997 |
| Dili | 0.984 |
| Roa | 0.713 |
| Fdamdd | 0.496 |
| Skinsen | 0.843 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.523 |
| Bcf | 1.31 |
| Igc50 | 5.553 |
| Lc50 | 6.111 |
| Lc50dm | 6.283 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.759 |
| Nr-ahr | 0.969 |
| Nr-aromatase | 0.957 |
| Nr-er | 0.887 |
| Nr-er-lbd | 0.228 |
| Nr-ppar-gamma | 0.947 |
| Sr-are | 0.977 |
| Sr-atad5 | 0.773 |
| Sr-hse | 0.874 |
| Sr-mmp | 0.988 |
| Sr-p53 | 0.994 |
| Vol | 551.441 |
| Dense | 1.027 |
| Flex | 0.152 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 5 |
| Qed | 0.332 |
| Synth | 3.937 |
| Fsp3 | 0.467 |
| Mce-18 | 114.909 |
| Natural product-likeness | -0.68 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |