| General Information | |
|---|---|
| ZINC ID | ZINC000042921835 |
| Molecular Weight (Da) | 332 |
| SMILES | CCCN(C)C(=O)N1CCc2c(nc(C(C)(C)C)n2CC2CC2)C1 |
| Molecular Formula | C19N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 97.088 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| LogP | 4.257 |
| Activity (Ki) in nM | 380.189 |
| Polar Surface Area (PSA) | 41.37 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.46961587 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 5 |
| Fraction csp3 | 0.79 |
| Ilogp | 3.6 |
| Xlogp3 | 2.71 |
| Wlogp | 2.82 |
| Mlogp | 2.52 |
| Silicos-it log p | 2.67 |
| Consensus log p | 2.86 |
| Esol log s | -3.3 |
| Esol solubility (mg/ml) | 1.66E-01 |
| Esol solubility (mol/l) | 5.00E-04 |
| Esol class | Soluble |
| Ali log s | -3.23 |
| Ali solubility (mg/ml) | 1.95E-01 |
| Ali solubility (mol/l) | 5.86E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -3.63 |
| Silicos-it solubility (mg/ml) | 7.76E-02 |
| Silicos-it solubility (mol/l) | 2.33E-04 |
| Silicos-it class | Soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.4 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.174 |
| Logd | 3.233 |
| Logp | 3.277 |
| F (20%) | 0.874 |
| F (30%) | 0.992 |
| Mdck | 1.28E-05 |
| Ppb | 0.8196 |
| Vdss | 1.477 |
| Fu | 0.2089 |
| Cyp1a2-inh | 0.176 |
| Cyp1a2-sub | 0.881 |
| Cyp2c19-inh | 0.807 |
| Cyp2c19-sub | 0.921 |
| Cl | 5.26 |
| T12 | 0.705 |
| H-ht | 0.6 |
| Dili | 0.18 |
| Roa | 0.421 |
| Fdamdd | 0.899 |
| Skinsen | 0.141 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.957 |
| Bcf | 1.157 |
| Igc50 | 2.205 |
| Lc50 | 3.252 |
| Lc50dm | 3.16 |
| Nr-ar | 0.482 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.034 |
| Nr-aromatase | 0.052 |
| Nr-er | 0.139 |
| Nr-er-lbd | 0.019 |
| Nr-ppar-gamma | 0.032 |
| Sr-are | 0.248 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.517 |
| Sr-mmp | 0.036 |
| Sr-p53 | 0.01 |
| Vol | 356.379 |
| Dense | 0.932 |
| Flex | 14 |
| Nstereo | 0.5 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.848 |
| Fsp3 | 2.922 |
| Mce-18 | 0.789 |
| Natural product-likeness | 47.059 |
| Alarm nmr | -1.378 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |