| General Information | |
|---|---|
| ZINC ID | ZINC000042922870 |
| Molecular Weight (Da) | 400 |
| SMILES | Cc1ccccc1[C@@H](c1ccc(Cl)cc1)N1CCN(C(=O)NC(C)(C)C)CC1 |
| Molecular Formula | C23Cl1N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.826 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| LogP | 5.529 |
| Activity (Ki) in nM | 331.131 |
| Polar Surface Area (PSA) | 35.58 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95693671 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.43 |
| Ilogp | 4.37 |
| Xlogp3 | 4.53 |
| Wlogp | 3.78 |
| Mlogp | 4.01 |
| Silicos-it log p | 4.24 |
| Consensus log p | 4.19 |
| Esol log s | -5.09 |
| Esol solubility (mg/ml) | 0.00322 |
| Esol solubility (mol/l) | 0.00000804 |
| Esol class | Moderately |
| Ali log s | -5 |
| Ali solubility (mg/ml) | 0.00401 |
| Ali solubility (mol/l) | 0.00001 |
| Ali class | Moderately |
| Silicos-it logsw | -6.88 |
| Silicos-it solubility (mg/ml) | 0.0000527 |
| Silicos-it solubility (mol/l) | 0.00000013 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.52 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.093 |
| Logd | 4.592 |
| Logp | 4.894 |
| F (20%) | 0.003 |
| F (30%) | 0.037 |
| Mdck | - |
| Ppb | 96.06% |
| Vdss | 1.549 |
| Fu | 2.57% |
| Cyp1a2-inh | 0.048 |
| Cyp1a2-sub | 0.737 |
| Cyp2c19-inh | 0.914 |
| Cyp2c19-sub | 0.951 |
| Cl | 2.557 |
| T12 | 0.166 |
| H-ht | 0.821 |
| Dili | 0.419 |
| Roa | 0.04 |
| Fdamdd | 0.377 |
| Skinsen | 0.032 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.094 |
| Bcf | 0.887 |
| Igc50 | 3.61 |
| Lc50 | 5.226 |
| Lc50dm | 3.297 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.001 |
| Nr-ahr | 0.145 |
| Nr-aromatase | 0.004 |
| Nr-er | 0.309 |
| Nr-er-lbd | 0.04 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.258 |
| Sr-atad5 | 0.001 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.723 |
| Sr-p53 | 0.507 |
| Vol | 419.231 |
| Dense | 0.952 |
| Flex | 0.316 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.799 |
| Synth | 2.596 |
| Fsp3 | 0.435 |
| Mce-18 | 64.848 |
| Natural product-likeness | -1.462 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |