| General Information | |
|---|---|
| ZINC ID | ZINC000043010662 |
| Molecular Weight (Da) | 276 |
| SMILES | CN(C)c1ccccc1C(=O)c1ccc2ccccc2n1 |
| Molecular Formula | C18N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 84.611 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| LogP | 4.011 |
| Activity (Ki) in nM | 794.328 |
| Polar Surface Area (PSA) | 33.2 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.97007077 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.11 |
| Ilogp | 2.83 |
| Xlogp3 | 3.99 |
| Wlogp | 3.53 |
| Mlogp | 2.39 |
| Silicos-it log p | 3.52 |
| Consensus log p | 3.25 |
| Esol log s | -4.43 |
| Esol solubility (mg/ml) | 1.02E-02 |
| Esol solubility (mol/l) | 3.69E-05 |
| Esol class | Moderately |
| Ali log s | -4.39 |
| Ali solubility (mg/ml) | 1.13E-02 |
| Ali solubility (mol/l) | 4.08E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -6.28 |
| Silicos-it solubility (mg/ml) | 1.47E-04 |
| Silicos-it solubility (mol/l) | 5.31E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.15 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.12 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.969 |
| Logd | 3.701 |
| Logp | 4.193 |
| F (20%) | 0.004 |
| F (30%) | 0.004 |
| Mdck | 1.81E-05 |
| Ppb | 0.9717 |
| Vdss | 0.735 |
| Fu | 0.0117 |
| Cyp1a2-inh | 0.982 |
| Cyp1a2-sub | 0.843 |
| Cyp2c19-inh | 0.819 |
| Cyp2c19-sub | 0.132 |
| Cl | 5.72 |
| T12 | 0.136 |
| H-ht | 0.166 |
| Dili | 0.875 |
| Roa | 0.241 |
| Fdamdd | 0.191 |
| Skinsen | 0.062 |
| Ec | 0.004 |
| Ei | 0.954 |
| Respiratory | 0.711 |
| Bcf | 1.949 |
| Igc50 | 4.625 |
| Lc50 | 5.49 |
| Lc50dm | 5.797 |
| Nr-ar | 0.487 |
| Nr-ar-lbd | 0.437 |
| Nr-ahr | 0.88 |
| Nr-aromatase | 0.666 |
| Nr-er | 0.931 |
| Nr-er-lbd | 0.729 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.813 |
| Sr-atad5 | 0.932 |
| Sr-hse | 0.007 |
| Sr-mmp | 0.767 |
| Sr-p53 | 0.675 |
| Vol | 301.27 |
| Dense | 0.917 |
| Flex | 18 |
| Nstereo | 0.167 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.686 |
| Fsp3 | 1.961 |
| Mce-18 | 0.111 |
| Natural product-likeness | 16 |
| Alarm nmr | -0.926 |
| Bms | 1 |
| Chelating | 1 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |