| General Information | |
|---|---|
| ZINC ID | ZINC000043011585 |
| Molecular Weight (Da) | 355 |
| SMILES | CCCn1c(C)c(C(=O)c2ccc(CC)c3ccccc23)c2ccccc21 |
| Molecular Formula | C25N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.762 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 6.512 |
| Activity (Ki) in nM | 70.7946 |
| Polar Surface Area (PSA) | 22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.031 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.24 |
| Ilogp | 3.88 |
| Xlogp3 | 6.62 |
| Wlogp | 6.31 |
| Mlogp | 4.4 |
| Silicos-it log p | 6.65 |
| Consensus log p | 5.57 |
| Esol log s | -6.41 |
| Esol solubility (mg/ml) | 0.00014 |
| Esol solubility (mol/l) | 0.00000039 |
| Esol class | Poorly sol |
| Ali log s | -6.88 |
| Ali solubility (mg/ml) | 0.0000466 |
| Ali solubility (mol/l) | 0.00000013 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.93 |
| Silicos-it solubility (mg/ml) | 0.00000041 |
| Silicos-it solubility (mol/l) | 1.17E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.77 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.75 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.398 |
| Logd | 4.843 |
| Logp | 6.395 |
| F (20%) | 0.731 |
| F (30%) | 0.995 |
| Mdck | - |
| Ppb | 99.35% |
| Vdss | 1.127 |
| Fu | 0.47% |
| Cyp1a2-inh | 0.877 |
| Cyp1a2-sub | 0.622 |
| Cyp2c19-inh | 0.868 |
| Cyp2c19-sub | 0.085 |
| Cl | 5.55 |
| T12 | 0.007 |
| H-ht | 0.114 |
| Dili | 0.892 |
| Roa | 0.114 |
| Fdamdd | 0.919 |
| Skinsen | 0.169 |
| Ec | 0.003 |
| Ei | 0.949 |
| Respiratory | 0.107 |
| Bcf | 2.018 |
| Igc50 | 5.353 |
| Lc50 | 6.474 |
| Lc50dm | 6.832 |
| Nr-ar | 0.058 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.825 |
| Nr-aromatase | 0.811 |
| Nr-er | 0.768 |
| Nr-er-lbd | 0.79 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.765 |
| Sr-atad5 | 0.173 |
| Sr-hse | 0.206 |
| Sr-mmp | 0.853 |
| Sr-p53 | 0.647 |
| Vol | 400.153 |
| Dense | 0.888 |
| Flex | 0.227 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.385 |
| Synth | 2.176 |
| Fsp3 | 0.24 |
| Mce-18 | 22 |
| Natural product-likeness | -0.551 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |