| General Information | |
|---|---|
| ZINC ID | ZINC000043018975 |
| Molecular Weight (Da) | 556 |
| SMILES | CCCCNc1cc(N[C@@H](C)[C@@H](Cc2ccc(Cl)cc2)c2cccc(Br)c2)nc(C(F)(F)F)n1 |
| Molecular Formula | C25Br1Cl1F3N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 136.125 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| LogP | 8.628 |
| Activity (Ki) in nM | 43.6516 |
| Polar Surface Area (PSA) | 49.84 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.218 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.36 |
| Ilogp | 4.99 |
| Xlogp3 | 8.47 |
| Wlogp | 8.72 |
| Mlogp | 5.67 |
| Silicos-it log p | 7.55 |
| Consensus log p | 7.08 |
| Esol log s | -8.29 |
| Esol solubility (mg/ml) | 0.00000286 |
| Esol solubility (mol/l) | 5.15E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.39 |
| Ali solubility (mg/ml) | 0.00000022 |
| Ali solubility (mol/l) | 4.10E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.39 |
| Silicos-it solubility (mg/ml) | 2.26E-09 |
| Silicos-it solubility (mol/l) | 4.07E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.68 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.14 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.679 |
| Logd | 4.886 |
| Logp | 7.372 |
| F (20%) | 0.004 |
| F (30%) | 0.018 |
| Mdck | - |
| Ppb | 99.19% |
| Vdss | 5.13 |
| Fu | 0.88% |
| Cyp1a2-inh | 0.537 |
| Cyp1a2-sub | 0.851 |
| Cyp2c19-inh | 0.88 |
| Cyp2c19-sub | 0.052 |
| Cl | 4.186 |
| T12 | 0.013 |
| H-ht | 0.581 |
| Dili | 0.911 |
| Roa | 0.981 |
| Fdamdd | 0.911 |
| Skinsen | 0.03 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.929 |
| Bcf | 2.332 |
| Igc50 | 5.097 |
| Lc50 | 6.413 |
| Lc50dm | 6.691 |
| Nr-ar | 0.144 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.348 |
| Nr-aromatase | 0.57 |
| Nr-er | 0.574 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.497 |
| Sr-atad5 | 0.02 |
| Sr-hse | 0.056 |
| Sr-mmp | 0.759 |
| Sr-p53 | 0.344 |
| Vol | 488.243 |
| Dense | 1.135 |
| Flex | 0.526 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.271 |
| Synth | 3.88 |
| Fsp3 | 0.36 |
| Mce-18 | 42 |
| Natural product-likeness | -0.804 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |