| General Information | |
|---|---|
| ZINC ID | ZINC000043021696 |
| Molecular Weight (Da) | 386 |
| SMILES | CCCCCn1c(C)c(C(=O)c2cccc3ccc(OC)cc23)c2ccccc21 |
| Molecular Formula | C26N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.785 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| LogP | 6.466 |
| Activity (Ki) in nM | 10.471 |
| Polar Surface Area (PSA) | 31.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.198 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.27 |
| Ilogp | 4.11 |
| Xlogp3 | 6.69 |
| Wlogp | 6.53 |
| Mlogp | 3.99 |
| Silicos-it log p | 6.59 |
| Consensus log p | 5.58 |
| Esol log s | -6.47 |
| Esol solubility (mg/ml) | 0.000131 |
| Esol solubility (mol/l) | 0.00000034 |
| Esol class | Poorly sol |
| Ali log s | -7.15 |
| Ali solubility (mg/ml) | 0.0000273 |
| Ali solubility (mol/l) | 7.09E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.05 |
| Silicos-it solubility (mg/ml) | 0.00000034 |
| Silicos-it solubility (mol/l) | 8.83E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.9 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.87 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.437 |
| Logd | 4.811 |
| Logp | 6.458 |
| F (20%) | 0.871 |
| F (30%) | 0.992 |
| Mdck | 1.22E-05 |
| Ppb | 0.987 |
| Vdss | 1.183 |
| Fu | 0.0063 |
| Cyp1a2-inh | 0.768 |
| Cyp1a2-sub | 0.831 |
| Cyp2c19-inh | 0.843 |
| Cyp2c19-sub | 0.081 |
| Cl | 6.716 |
| T12 | 0.009 |
| H-ht | 0.227 |
| Dili | 0.93 |
| Roa | 0.094 |
| Fdamdd | 0.94 |
| Skinsen | 0.252 |
| Ec | 0.003 |
| Ei | 0.931 |
| Respiratory | 0.165 |
| Bcf | 1.75 |
| Igc50 | 5.504 |
| Lc50 | 6.483 |
| Lc50dm | 6.919 |
| Nr-ar | 0.033 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.825 |
| Nr-aromatase | 0.824 |
| Nr-er | 0.785 |
| Nr-er-lbd | 0.665 |
| Nr-ppar-gamma | 0.01 |
| Sr-are | 0.789 |
| Sr-atad5 | 0.633 |
| Sr-hse | 0.025 |
| Sr-mmp | 0.834 |
| Sr-p53 | 0.662 |
| Vol | 426.239 |
| Dense | 0.904 |
| Flex | 0.318 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.267 |
| Synth | 2.143 |
| Fsp3 | 0.269 |
| Mce-18 | 22 |
| Natural product-likeness | -0.594 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |