| General Information | |
|---|---|
| ZINC ID | ZINC000043064993 |
| Molecular Weight (Da) | 488 |
| SMILES | CCCCNc1cc(N[C@@H](C)[C@@H](Cc2ccc(Cl)cc2)c2cccc(Br)c2)ncn1 |
| Molecular Formula | C24Br1Cl1N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 133.023 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| LogP | 7.584 |
| Activity (Ki) in nM | 2951.209 |
| Polar Surface Area (PSA) | 49.84 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.016 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.7 |
| Xlogp3 | 7.55 |
| Wlogp | 6.55 |
| Mlogp | 5.17 |
| Silicos-it log p | 6.44 |
| Consensus log p | 6.08 |
| Esol log s | -7.41 |
| Esol solubility (mg/ml) | 0.0000192 |
| Esol solubility (mol/l) | 3.93E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.43 |
| Ali solubility (mg/ml) | 0.0000018 |
| Ali solubility (mol/l) | 3.69E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.58 |
| Silicos-it solubility (mg/ml) | 1.27E-08 |
| Silicos-it solubility (mol/l) | 2.61E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.92 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.91 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.368 |
| Logd | 4.68 |
| Logp | 6.755 |
| F (20%) | 0.003 |
| F (30%) | 0.043 |
| Mdck | 1.60E-05 |
| Ppb | 0.9784 |
| Vdss | 3.903 |
| Fu | 0.0202 |
| Cyp1a2-inh | 0.962 |
| Cyp1a2-sub | 0.309 |
| Cyp2c19-inh | 0.968 |
| Cyp2c19-sub | 0.075 |
| Cl | 5.621 |
| T12 | 0.037 |
| H-ht | 0.389 |
| Dili | 0.762 |
| Roa | 0.769 |
| Fdamdd | 0.883 |
| Skinsen | 0.165 |
| Ec | 0.003 |
| Ei | 0.044 |
| Respiratory | 0.953 |
| Bcf | 2.819 |
| Igc50 | 5.141 |
| Lc50 | 6.251 |
| Lc50dm | 6.418 |
| Nr-ar | 0.025 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.821 |
| Nr-aromatase | 0.932 |
| Nr-er | 0.482 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.376 |
| Sr-atad5 | 0.055 |
| Sr-hse | 0.527 |
| Sr-mmp | 0.849 |
| Sr-p53 | 0.215 |
| Vol | 452.744 |
| Dense | 1.074 |
| Flex | 0.474 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.345 |
| Synth | 3.768 |
| Fsp3 | 0.333 |
| Mce-18 | 34 |
| Natural product-likeness | -0.65 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |