| General Information | |
|---|---|
| ZINC ID | ZINC000043077673 |
| Molecular Weight (Da) | 515 |
| SMILES | C[C@H](Nc1cc(OC2CCCCC2)ncn1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| Molecular Formula | C26Br1Cl1N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 136.432 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| LogP | 8.288 |
| Activity (Ki) in nM | 95.4993 |
| Polar Surface Area (PSA) | 47.04 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.13725674 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.38 |
| Ilogp | 4.4 |
| Xlogp3 | 8.09 |
| Wlogp | 7.24 |
| Mlogp | 5.57 |
| Silicos-it log p | 6.73 |
| Consensus log p | 6.41 |
| Esol log s | -8.02 |
| Esol solubility (mg/ml) | 0.00000495 |
| Esol solubility (mol/l) | 9.61E-09 |
| Esol class | Poorly sol |
| Ali log s | -8.93 |
| Ali solubility (mg/ml) | 0.00000059 |
| Ali solubility (mol/l) | 1.16E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.08 |
| Silicos-it solubility (mg/ml) | 4.32E-08 |
| Silicos-it solubility (mol/l) | 8.39E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.7 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.384 |
| Logd | 4.744 |
| Logp | 7.012 |
| F (20%) | 0.005 |
| F (30%) | 0.056 |
| Mdck | - |
| Ppb | 98.86% |
| Vdss | 2.915 |
| Fu | 0.69% |
| Cyp1a2-inh | 0.401 |
| Cyp1a2-sub | 0.223 |
| Cyp2c19-inh | 0.865 |
| Cyp2c19-sub | 0.061 |
| Cl | 4.331 |
| T12 | 0.011 |
| H-ht | 0.26 |
| Dili | 0.835 |
| Roa | 0.802 |
| Fdamdd | 0.919 |
| Skinsen | 0.182 |
| Ec | 0.003 |
| Ei | 0.073 |
| Respiratory | 0.418 |
| Bcf | 3.362 |
| Igc50 | 5.388 |
| Lc50 | 6.708 |
| Lc50dm | 6.523 |
| Nr-ar | 0.254 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.518 |
| Nr-aromatase | 0.948 |
| Nr-er | 0.349 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.098 |
| Sr-are | 0.42 |
| Sr-atad5 | 0.022 |
| Sr-hse | 0.782 |
| Sr-mmp | 0.88 |
| Sr-p53 | 0.468 |
| Vol | 476.573 |
| Dense | 1.077 |
| Flex | 0.28 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.375 |
| Synth | 3.843 |
| Fsp3 | 0.385 |
| Mce-18 | 70 |
| Natural product-likeness | -0.35 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |