| General Information | |
|---|---|
| ZINC ID | ZINC000043118327 |
| Molecular Weight (Da) | 357 |
| SMILES | CCCn1c(C)c(C(=O)c2cccc3ccc(OC)cc23)c2ccccc21 |
| Molecular Formula | C24N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 107.583 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 5.553 |
| Activity (Ki) in nM | 436.516 |
| Polar Surface Area (PSA) | 31.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.17600035 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.21 |
| Ilogp | 3.74 |
| Xlogp3 | 5.79 |
| Wlogp | 5.75 |
| Mlogp | 3.58 |
| Silicos-it log p | 5.79 |
| Consensus log p | 4.93 |
| Esol log s | -5.89 |
| Esol solubility (mg/ml) | 0.000456 |
| Esol solubility (mol/l) | 0.00000127 |
| Esol class | Moderately |
| Ali log s | -6.22 |
| Ali solubility (mg/ml) | 0.000218 |
| Ali solubility (mol/l) | 0.0000006 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.27 |
| Silicos-it solubility (mg/ml) | 0.00000194 |
| Silicos-it solubility (mol/l) | 5.42E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.37 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.66 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.198 |
| Logd | 4.412 |
| Logp | 5.803 |
| F (20%) | 0.735 |
| F (30%) | 0.987 |
| Mdck | 1.80E-05 |
| Ppb | 0.9902 |
| Vdss | 0.874 |
| Fu | 0.0062 |
| Cyp1a2-inh | 0.869 |
| Cyp1a2-sub | 0.911 |
| Cyp2c19-inh | 0.872 |
| Cyp2c19-sub | 0.1 |
| Cl | 7.341 |
| T12 | 0.014 |
| H-ht | 0.223 |
| Dili | 0.925 |
| Roa | 0.084 |
| Fdamdd | 0.944 |
| Skinsen | 0.123 |
| Ec | 0.003 |
| Ei | 0.926 |
| Respiratory | 0.17 |
| Bcf | 2.091 |
| Igc50 | 5.307 |
| Lc50 | 6.508 |
| Lc50dm | 6.943 |
| Nr-ar | 0.028 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.862 |
| Nr-aromatase | 0.786 |
| Nr-er | 0.817 |
| Nr-er-lbd | 0.712 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.759 |
| Sr-atad5 | 0.59 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.83 |
| Sr-p53 | 0.68 |
| Vol | 391.647 |
| Dense | 0.912 |
| Flex | 0.227 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.426 |
| Synth | 2.104 |
| Fsp3 | 0.208 |
| Mce-18 | 22 |
| Natural product-likeness | -0.691 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |