| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000043119975 |
| Molecular Weight (Da) | 400 |
| SMILES | CCCCCn1c(C)c(C(=O)c2ccc(OCC)c3ccccc23)c2ccccc21 |
| Molecular Formula | C27N1O2 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000043119975 |
| Molecular Weight (Da) | 400 |
| SMILES | CCCCCn1c(C)c(C(=O)c2ccc(OCC)c3ccccc23)c2ccccc21 |
| Molecular Formula | C27N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000043119975 |
| Molar Refractivity | 121.533 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| LogP | 6.814 |
| Activity (Ki) in nM | 28.8403 |
| Polar Surface Area (PSA) | 31.23 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000043119975 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | + |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.091 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.54 |
| Xlogp3 | 7.06 |
| Wlogp | 6.92 |
| Mlogp | 4.19 |
| Silicos-it log p | 6.99 |
| Consensus log p | 5.94 |
| Esol log s | -6.71 |
| Esol solubility (mg/ml) | 0.0000787 |
| Esol solubility (mol/l) | 0.00000019 |
| Esol class | Poorly sol |
| Ali log s | -7.53 |
| Ali solubility (mg/ml) | 0.0000117 |
| Ali solubility (mol/l) | 2.93E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.45 |
| Silicos-it solubility (mg/ml) | 0.00000014 |
| Silicos-it solubility (mol/l) | 3.57E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.72 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 2.99 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -7.474 |
| Logd | 5.068 |
| Logp | 6.638 |
| F (20%) | 0.761 |
| F (30%) | 0.994 |
| Mdck | - |
| Ppb | 98.68% |
| Vdss | 1.567 |
| Fu | 0.46% |
| Cyp1a2-inh | 0.688 |
| Cyp1a2-sub | 0.4 |
| Cyp2c19-inh | 0.869 |
| Cyp2c19-sub | 0.077 |
| Cl | 4.945 |
| T12 | 0.007 |
| H-ht | 0.061 |
| Dili | 0.912 |
| Roa | 0.099 |
| Fdamdd | 0.877 |
| Skinsen | 0.098 |
| Ec | 0.003 |
| Ei | 0.937 |
| Respiratory | 0.115 |
| Bcf | 1.638 |
| Igc50 | 5.516 |
| Lc50 | 6.601 |
| Lc50dm | 6.876 |
| Nr-ar | 0.078 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.835 |
| Nr-aromatase | 0.859 |
| Nr-er | 0.527 |
| Nr-er-lbd | 0.726 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.829 |
| Sr-atad5 | 0.093 |
| Sr-hse | 0.293 |
| Sr-mmp | 0.824 |
| Sr-p53 | 0.586 |
| Vol | 443.535 |
| Dense | 0.9 |
| Flex | 0.364 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.238 |
| Synth | 2.168 |
| Fsp3 | 0.296 |
| Mce-18 | 22 |
| Natural product-likeness | -0.661 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |