| General Information | |
|---|---|
| ZINC ID | ZINC000043120483 |
| Molecular Weight (Da) | 474 |
| SMILES | Cc1nc(N[C@@H](C)[C@@H](Cc2ccc(Cl)cc2)c2cccc(Br)c2)cc(N(C)C)n1 |
| Molecular Formula | C23Br1Cl1N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.95 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| LogP | 6.564 |
| Activity (Ki) in nM | 128.825 |
| Polar Surface Area (PSA) | 41.05 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.86510694 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.53 |
| Xlogp3 | 6.83 |
| Wlogp | 5.9 |
| Mlogp | 4.57 |
| Silicos-it log p | 5.73 |
| Consensus log p | 5.51 |
| Esol log s | -7.08 |
| Esol solubility (mg/ml) | 0.0000396 |
| Esol solubility (mol/l) | 8.36E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.5 |
| Ali solubility (mg/ml) | 0.000015 |
| Ali solubility (mol/l) | 3.16E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.44 |
| Silicos-it solubility (mg/ml) | 0.00000017 |
| Silicos-it solubility (mol/l) | 3.60E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.34 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.746 |
| Logd | 4.281 |
| Logp | 5.992 |
| F (20%) | 0.004 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 97.20% |
| Vdss | 2.234 |
| Fu | 5.24% |
| Cyp1a2-inh | 0.934 |
| Cyp1a2-sub | 0.941 |
| Cyp2c19-inh | 0.868 |
| Cyp2c19-sub | 0.196 |
| Cl | 3.505 |
| T12 | 0.035 |
| H-ht | 0.31 |
| Dili | 0.834 |
| Roa | 0.954 |
| Fdamdd | 0.918 |
| Skinsen | 0.037 |
| Ec | 0.003 |
| Ei | 0.033 |
| Respiratory | 0.831 |
| Bcf | 3.123 |
| Igc50 | 4.767 |
| Lc50 | 6.129 |
| Lc50dm | 6.613 |
| Nr-ar | 0.611 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.373 |
| Nr-aromatase | 0.028 |
| Nr-er | 0.512 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.002 |
| Sr-are | 0.254 |
| Sr-atad5 | 0.016 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.591 |
| Sr-p53 | 0.35 |
| Vol | 435.448 |
| Dense | 1.084 |
| Flex | 0.316 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.512 |
| Synth | 3.851 |
| Fsp3 | 0.304 |
| Mce-18 | 38 |
| Natural product-likeness | -0.717 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |