| General Information | |
|---|---|
| ZINC ID | ZINC000043121877 |
| Molecular Weight (Da) | 523 |
| SMILES | C[C@H](Nc1cc(NCc2ccccn2)ncn1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| Molecular Formula | C26Br1Cl1N5 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.233 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| LogP | 6.903 |
| Activity (Ki) in nM | 263.027 |
| Polar Surface Area (PSA) | 62.73 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.93013918 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.19 |
| Ilogp | 4.17 |
| Xlogp3 | 6.75 |
| Wlogp | 6.19 |
| Mlogp | 4.52 |
| Silicos-it log p | 6.13 |
| Consensus log p | 5.55 |
| Esol log s | -7.28 |
| Esol solubility (mg/ml) | 0.0000275 |
| Esol solubility (mol/l) | 5.27E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.87 |
| Ali solubility (mg/ml) | 0.000007 |
| Ali solubility (mol/l) | 1.34E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.49 |
| Silicos-it solubility (mg/ml) | 1.69E-09 |
| Silicos-it solubility (mol/l) | 3.23E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.7 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.526 |
| Logd | 4.115 |
| Logp | 5.529 |
| F (20%) | 0.008 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 98.11% |
| Vdss | 3.644 |
| Fu | 1.31% |
| Cyp1a2-inh | 0.958 |
| Cyp1a2-sub | 0.339 |
| Cyp2c19-inh | 0.97 |
| Cyp2c19-sub | 0.067 |
| Cl | 4.043 |
| T12 | 0.094 |
| H-ht | 0.746 |
| Dili | 0.878 |
| Roa | 0.555 |
| Fdamdd | 0.925 |
| Skinsen | 0.066 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.944 |
| Bcf | 2.389 |
| Igc50 | 4.981 |
| Lc50 | 6.011 |
| Lc50dm | 6.368 |
| Nr-ar | 0.272 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.879 |
| Nr-aromatase | 0.948 |
| Nr-er | 0.526 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.575 |
| Sr-atad5 | 0.463 |
| Sr-hse | 0.673 |
| Sr-mmp | 0.85 |
| Sr-p53 | 0.359 |
| Vol | 481.867 |
| Dense | 1.081 |
| Flex | 0.32 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.292 |
| Synth | 3.769 |
| Fsp3 | 0.192 |
| Mce-18 | 42 |
| Natural product-likeness | -0.999 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |