| General Information | |
|---|---|
| ZINC ID | ZINC000043130230 |
| Molecular Weight (Da) | 458 |
| SMILES | O=C(O)Cc1csc(NC(=O)c2cc3c(n(CC4CCCCC4)c2=O)CCCCCC3)n1 |
| Molecular Formula | C24N3O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.876 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| LogP | 5.159 |
| Activity (Ki) in nM | 10.965 |
| Polar Surface Area (PSA) | 129.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.77007514 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.58 |
| Ilogp | 2.5 |
| Xlogp3 | 4.5 |
| Wlogp | 4.23 |
| Mlogp | 2.53 |
| Silicos-it log p | 4.95 |
| Consensus log p | 3.74 |
| Esol log s | -5.3 |
| Esol solubility (mg/ml) | 0.00227 |
| Esol solubility (mol/l) | 0.00000496 |
| Esol class | Moderately |
| Ali log s | -6.94 |
| Ali solubility (mg/ml) | 0.0000524 |
| Ali solubility (mol/l) | 0.00000011 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.67 |
| Silicos-it solubility (mg/ml) | 0.000967 |
| Silicos-it solubility (mol/l) | 0.00000211 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.9 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.56 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.95 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.421 |
| Logd | 3.046 |
| Logp | 4.98 |
| F (20%) | 0.997 |
| F (30%) | 0.929 |
| Mdck | 2.72E-05 |
| Ppb | 0.9672 |
| Vdss | 0.32 |
| Fu | 0.007 |
| Cyp1a2-inh | 0.585 |
| Cyp1a2-sub | 0.169 |
| Cyp2c19-inh | 0.913 |
| Cyp2c19-sub | 0.061 |
| Cl | 1.455 |
| T12 | 0.324 |
| H-ht | 0.974 |
| Dili | 0.959 |
| Roa | 0.569 |
| Fdamdd | 0.791 |
| Skinsen | 0.165 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.777 |
| Bcf | 0.873 |
| Igc50 | 4.693 |
| Lc50 | 5.335 |
| Lc50dm | 4.516 |
| Nr-ar | 0.02 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.163 |
| Nr-aromatase | 0.163 |
| Nr-er | 0.219 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.984 |
| Sr-are | 0.224 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.107 |
| Sr-mmp | 0.236 |
| Sr-p53 | 0.07 |
| Vol | 457.639 |
| Dense | 0.999 |
| Flex | 0.214 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.712 |
| Synth | 3.203 |
| Fsp3 | 0.583 |
| Mce-18 | 57.895 |
| Natural product-likeness | -1.144 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |