| General Information | |
|---|---|
| ZINC ID | ZINC000043202202 |
| Molecular Weight (Da) | 392 |
| SMILES | CCCCC1=NN(C(=O)NC(C)(C)c2ccccc2)C(C)(C)[C@H]1c1ccccc1 |
| Molecular Formula | C25N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.349 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 5.863 |
| Activity (Ki) in nM | 7.9433 |
| Polar Surface Area (PSA) | 44.7 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.098 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.44 |
| Ilogp | 4.47 |
| Xlogp3 | 5.11 |
| Wlogp | 5.19 |
| Mlogp | 4.68 |
| Silicos-it log p | 5.36 |
| Consensus log p | 4.96 |
| Esol log s | -5.27 |
| Esol solubility (mg/ml) | 0.00213 |
| Esol solubility (mol/l) | 0.00000543 |
| Esol class | Moderately |
| Ali log s | -5.79 |
| Ali solubility (mg/ml) | 0.000631 |
| Ali solubility (mol/l) | 0.00000161 |
| Ali class | Moderately |
| Silicos-it logsw | -8 |
| Silicos-it solubility (mg/ml) | 0.00000392 |
| Silicos-it solubility (mol/l) | 0.00000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.06 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.943 |
| Logd | 4.679 |
| Logp | 5.803 |
| F (20%) | 0.009 |
| F (30%) | 0.004 |
| Mdck | - |
| Ppb | 96.20% |
| Vdss | 1.724 |
| Fu | 2.43% |
| Cyp1a2-inh | 0.21 |
| Cyp1a2-sub | 0.644 |
| Cyp2c19-inh | 0.906 |
| Cyp2c19-sub | 0.945 |
| Cl | 1.684 |
| T12 | 0.107 |
| H-ht | 0.062 |
| Dili | 0.976 |
| Roa | 0.077 |
| Fdamdd | 0.339 |
| Skinsen | 0.273 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.916 |
| Bcf | 1.278 |
| Igc50 | 4.375 |
| Lc50 | 6.631 |
| Lc50dm | 4.82 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.001 |
| Nr-ahr | 0.51 |
| Nr-aromatase | 0.272 |
| Nr-er | 0.721 |
| Nr-er-lbd | 0.395 |
| Nr-ppar-gamma | 0.05 |
| Sr-are | 0.455 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.604 |
| Sr-mmp | 0.908 |
| Sr-p53 | 0.055 |
| Vol | 435.976 |
| Dense | 0.897 |
| Flex | 0.444 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.639 |
| Synth | 3.141 |
| Fsp3 | 0.44 |
| Mce-18 | 65.333 |
| Natural product-likeness | -0.388 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |