| General Information | |
|---|---|
| ZINC ID | ZINC000045245653 |
| Molecular Weight (Da) | 345 |
| SMILES | Cc1cc(C)c(NC(=O)[C@@H]2CCCC[C@H]2C)cc1CN1CCOCC1 |
| Molecular Formula | C21N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.591 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 4.062 |
| Activity (Ki) in nM | 436.516 |
| Polar Surface Area (PSA) | 41.57 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.747509 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.67 |
| Ilogp | 3.93 |
| Xlogp3 | 3.81 |
| Wlogp | 3.18 |
| Mlogp | 2.8 |
| Silicos-it log p | 4.15 |
| Consensus log p | 3.57 |
| Esol log s | -4.22 |
| Esol solubility (mg/ml) | 2.06E-02 |
| Esol solubility (mol/l) | 5.97E-05 |
| Esol class | Moderately |
| Ali log s | -4.38 |
| Ali solubility (mg/ml) | 1.44E-02 |
| Ali solubility (mol/l) | 4.19E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.32 |
| Silicos-it solubility (mg/ml) | 1.65E-03 |
| Silicos-it solubility (mol/l) | 4.79E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.7 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.46 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.916 |
| Logd | 3.959 |
| Logp | 4.151 |
| F (20%) | 0.724 |
| F (30%) | 0.016 |
| Mdck | 2.67E-05 |
| Ppb | 0.9413 |
| Vdss | 1.395 |
| Fu | 0.0563 |
| Cyp1a2-inh | 0.061 |
| Cyp1a2-sub | 0.737 |
| Cyp2c19-inh | 0.566 |
| Cyp2c19-sub | 0.913 |
| Cl | 10.214 |
| T12 | 0.245 |
| H-ht | 0.687 |
| Dili | 0.853 |
| Roa | 0.314 |
| Fdamdd | 0.113 |
| Skinsen | 0.846 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.936 |
| Bcf | 1.046 |
| Igc50 | 3.319 |
| Lc50 | 4.579 |
| Lc50dm | 4.694 |
| Nr-ar | 0.402 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.632 |
| Nr-aromatase | 0.427 |
| Nr-er | 0.249 |
| Nr-er-lbd | 0.014 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.191 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.058 |
| Sr-mmp | 0.073 |
| Sr-p53 | 0.056 |
| Vol | 375.131 |
| Dense | 0.918 |
| Flex | 19 |
| Nstereo | 0.263 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.901 |
| Fsp3 | 2.964 |
| Mce-18 | 0.667 |
| Natural product-likeness | 60.714 |
| Alarm nmr | -1.406 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Rejected |