| General Information | |
|---|---|
| ZINC ID | ZINC000045254952 |
| Molecular Weight (Da) | 445 |
| SMILES | Cc1c(-c2cn(-c3ccccc3)cn2)nn(-c2ccccc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C25Cl2N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.397 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 7.211 |
| Activity (Ki) in nM | 3.8019 |
| Polar Surface Area (PSA) | 35.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.204 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 28 |
| Fraction csp3 | 0.04 |
| Ilogp | 4.24 |
| Xlogp3 | 6.62 |
| Wlogp | 7.01 |
| Mlogp | 4.92 |
| Silicos-it log p | 5.75 |
| Consensus log p | 5.71 |
| Esol log s | -7.18 |
| Esol solubility (mg/ml) | 0.0000297 |
| Esol solubility (mol/l) | 6.67E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.17 |
| Ali solubility (mg/ml) | 0.0000302 |
| Ali solubility (mol/l) | 6.77E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.99 |
| Silicos-it solubility (mg/ml) | 4.57E-08 |
| Silicos-it solubility (mol/l) | 1.03E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.32 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.001 |
| Logd | 5.058 |
| Logp | 6.302 |
| F (20%) | 0.012 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 98.61% |
| Vdss | 1.667 |
| Fu | 1.12% |
| Cyp1a2-inh | 0.609 |
| Cyp1a2-sub | 0.193 |
| Cyp2c19-inh | 0.886 |
| Cyp2c19-sub | 0.074 |
| Cl | 6.059 |
| T12 | 0.036 |
| H-ht | 0.087 |
| Dili | 0.988 |
| Roa | 0.26 |
| Fdamdd | 0.793 |
| Skinsen | 0.119 |
| Ec | 0.003 |
| Ei | 0.039 |
| Respiratory | 0.029 |
| Bcf | 3.821 |
| Igc50 | 5.129 |
| Lc50 | 6.695 |
| Lc50dm | 5.233 |
| Nr-ar | 0.076 |
| Nr-ar-lbd | 0.08 |
| Nr-ahr | 0.726 |
| Nr-aromatase | 0.959 |
| Nr-er | 0.92 |
| Nr-er-lbd | 0.754 |
| Nr-ppar-gamma | 0.021 |
| Sr-are | 0.926 |
| Sr-atad5 | 0.879 |
| Sr-hse | 0.266 |
| Sr-mmp | 0.913 |
| Sr-p53 | 0.941 |
| Vol | 438.309 |
| Dense | 1.013 |
| Flex | 0.143 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.298 |
| Synth | 2.401 |
| Fsp3 | 0.04 |
| Mce-18 | 26 |
| Natural product-likeness | -1.464 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |