| General Information | |
|---|---|
| ZINC ID | ZINC000045260306 |
| Molecular Weight (Da) | 461 |
| SMILES | Cc1ccnc(NC(C)(C)C(=O)N[C@@H](C)[C@@H](Cc2ccc(Cl)cc2)c2cccc(C#N)c2)c1 |
| Molecular Formula | C27Cl1N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 134.955 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| LogP | 6.005 |
| Activity (Ki) in nM | 549.541 |
| Polar Surface Area (PSA) | 77.81 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.879 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.27 |
| Xlogp3 | 5.95 |
| Wlogp | 5.45 |
| Mlogp | 3.55 |
| Silicos-it log p | 6.02 |
| Consensus log p | 5.05 |
| Esol log s | -6.26 |
| Esol solubility (mg/ml) | 0.000255 |
| Esol solubility (mol/l) | 0.00000055 |
| Esol class | Poorly sol |
| Ali log s | -7.36 |
| Ali solubility (mg/ml) | 0.0000201 |
| Ali solubility (mol/l) | 4.37E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.78 |
| Silicos-it solubility (mg/ml) | 7.72E-08 |
| Silicos-it solubility (mol/l) | 1.67E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.89 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.95 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.271 |
| Logd | 4.332 |
| Logp | 5.676 |
| F (20%) | 0.005 |
| F (30%) | 0.001 |
| Mdck | 1.86E-05 |
| Ppb | 0.9803 |
| Vdss | 1.055 |
| Fu | 0.0135 |
| Cyp1a2-inh | 0.711 |
| Cyp1a2-sub | 0.81 |
| Cyp2c19-inh | 0.972 |
| Cyp2c19-sub | 0.469 |
| Cl | 6.21 |
| T12 | 0.071 |
| H-ht | 0.828 |
| Dili | 0.793 |
| Roa | 0.842 |
| Fdamdd | 0.926 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.872 |
| Bcf | 0.874 |
| Igc50 | 4.002 |
| Lc50 | 5.13 |
| Lc50dm | 5.707 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.013 |
| Nr-aromatase | 0.128 |
| Nr-er | 0.591 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.057 |
| Sr-are | 0.325 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.013 |
| Sr-mmp | 0.596 |
| Sr-p53 | 0.016 |
| Vol | 486.23 |
| Dense | 0.946 |
| Flex | 0.381 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.516 |
| Synth | 3.821 |
| Fsp3 | 0.296 |
| Mce-18 | 42 |
| Natural product-likeness | -0.828 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |