| General Information | |
|---|---|
| ZINC ID | ZINC000045261006 |
| Molecular Weight (Da) | 312 |
| SMILES | CC1(C)C(C(=O)c2cn(CCC(N)=O)c3ccccc23)C1(C)C |
| Molecular Formula | C19N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 88.5 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| LogP | 2.586 |
| Activity (Ki) in nM | 218.776 |
| Polar Surface Area (PSA) | 65.09 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.90423655 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.47 |
| Ilogp | 2.69 |
| Xlogp3 | 2.59 |
| Wlogp | 3.38 |
| Mlogp | 2.1 |
| Silicos-it log p | 3.4 |
| Consensus log p | 2.83 |
| Esol log s | -3.37 |
| Esol solubility (mg/ml) | 1.34E-01 |
| Esol solubility (mol/l) | 4.28E-04 |
| Esol class | Soluble |
| Ali log s | -3.61 |
| Ali solubility (mg/ml) | 7.74E-02 |
| Ali solubility (mol/l) | 2.48E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -4.92 |
| Silicos-it solubility (mg/ml) | 3.80E-03 |
| Silicos-it solubility (mol/l) | 1.22E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.37 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 2.54 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.698 |
| Logd | 3.001 |
| Logp | 3.202 |
| F (20%) | 0.005 |
| F (30%) | 0.003 |
| Mdck | 2.38E-05 |
| Ppb | 0.8311 |
| Vdss | 1.433 |
| Fu | 0.1902 |
| Cyp1a2-inh | 0.224 |
| Cyp1a2-sub | 0.34 |
| Cyp2c19-inh | 0.616 |
| Cyp2c19-sub | 0.429 |
| Cl | 4.394 |
| T12 | 0.091 |
| H-ht | 0.208 |
| Dili | 0.8 |
| Roa | 0.153 |
| Fdamdd | 0.413 |
| Skinsen | 0.111 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.711 |
| Bcf | 1.077 |
| Igc50 | 3.857 |
| Lc50 | 3.903 |
| Lc50dm | 5.175 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.248 |
| Nr-aromatase | 0.008 |
| Nr-er | 0.232 |
| Nr-er-lbd | 0.33 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.148 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.234 |
| Sr-p53 | 0.01 |
| Vol | 335.266 |
| Dense | 0.931 |
| Flex | 15 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.86 |
| Fsp3 | 2.489 |
| Mce-18 | 0.474 |
| Natural product-likeness | 48.714 |
| Alarm nmr | -0.693 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |