| General Information | |
|---|---|
| ZINC ID | ZINC000045283653 |
| Molecular Weight (Da) | 497 |
| SMILES | C[C@H](NC(=O)C(C)(C)Nc1cc2ccccc2cn1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C30Cl1N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 146.364 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| LogP | 6.427 |
| Activity (Ki) in nM | 117.49 |
| Polar Surface Area (PSA) | 77.81 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.109 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.9 |
| Xlogp3 | 6.84 |
| Wlogp | 6.29 |
| Mlogp | 3.96 |
| Silicos-it log p | 6.54 |
| Consensus log p | 5.51 |
| Esol log s | -7.09 |
| Esol solubility (mg/ml) | 0.0000405 |
| Esol solubility (mol/l) | 8.15E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.28 |
| Ali solubility (mg/ml) | 0.00000259 |
| Ali solubility (mol/l) | 5.21E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.03 |
| Silicos-it solubility (mg/ml) | 4.69E-09 |
| Silicos-it solubility (mol/l) | 9.44E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.48 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.03 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.256 |
| Logd | 4.519 |
| Logp | 6.379 |
| F (20%) | 0.031 |
| F (30%) | 0.001 |
| Mdck | 8.50E-06 |
| Ppb | 0.9929 |
| Vdss | 1.419 |
| Fu | 0.007 |
| Cyp1a2-inh | 0.745 |
| Cyp1a2-sub | 0.853 |
| Cyp2c19-inh | 0.935 |
| Cyp2c19-sub | 0.164 |
| Cl | 6.305 |
| T12 | 0.044 |
| H-ht | 0.882 |
| Dili | 0.896 |
| Roa | 0.57 |
| Fdamdd | 0.965 |
| Skinsen | 0.06 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.835 |
| Bcf | 1.31 |
| Igc50 | 4.584 |
| Lc50 | 5.896 |
| Lc50dm | 6.264 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.293 |
| Nr-aromatase | 0.88 |
| Nr-er | 0.622 |
| Nr-er-lbd | 0.014 |
| Nr-ppar-gamma | 0.079 |
| Sr-are | 0.587 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.023 |
| Sr-mmp | 0.727 |
| Sr-p53 | 0.232 |
| Vol | 524.288 |
| Dense | 0.946 |
| Flex | 0.308 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.334 |
| Synth | 3.798 |
| Fsp3 | 0.233 |
| Mce-18 | 50 |
| Natural product-likeness | -0.662 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |