| General Information | |
|---|---|
| ZINC ID | ZINC000045284351 |
| Molecular Weight (Da) | 446 |
| SMILES | Cc1c(C(=O)Nc2ccc(Cl)cc2)nn(-c2ccc(Cl)cc2Cl)c1-n1cccc1 |
| Molecular Formula | C21Cl3N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.675 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 5.977 |
| Activity (Ki) in nM | 79.433 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.00123369 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.05 |
| Ilogp | 3.74 |
| Xlogp3 | 6.04 |
| Wlogp | 5.99 |
| Mlogp | 4.82 |
| Silicos-it log p | 4.55 |
| Consensus log p | 5.03 |
| Esol log s | -6.64 |
| Esol solubility (mg/ml) | 0.000102 |
| Esol solubility (mol/l) | 0.00000022 |
| Esol class | Poorly sol |
| Ali log s | -6.91 |
| Ali solubility (mg/ml) | 0.0000551 |
| Ali solubility (mol/l) | 0.00000012 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.46 |
| Silicos-it solubility (mg/ml) | 0.00000154 |
| Silicos-it solubility (mol/l) | 3.46E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.73 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.04 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.052 |
| Logd | 4.1 |
| Logp | 5.771 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 9.57E-06 |
| Ppb | 0.9956 |
| Vdss | 0.517 |
| Fu | 0.0114 |
| Cyp1a2-inh | 0.579 |
| Cyp1a2-sub | 0.653 |
| Cyp2c19-inh | 0.954 |
| Cyp2c19-sub | 0.192 |
| Cl | 1.989 |
| T12 | 0.137 |
| H-ht | 0.193 |
| Dili | 0.983 |
| Roa | 0.162 |
| Fdamdd | 0.824 |
| Skinsen | 0.157 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.022 |
| Bcf | 3.271 |
| Igc50 | 4.842 |
| Lc50 | 5.801 |
| Lc50dm | 5.244 |
| Nr-ar | 0.048 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.967 |
| Nr-aromatase | 0.973 |
| Nr-er | 0.853 |
| Nr-er-lbd | 0.463 |
| Nr-ppar-gamma | 0.771 |
| Sr-are | 0.944 |
| Sr-atad5 | 0.686 |
| Sr-hse | 0.572 |
| Sr-mmp | 0.963 |
| Sr-p53 | 0.957 |
| Vol | 406.956 |
| Dense | 1.091 |
| Flex | 0.217 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.407 |
| Synth | 2.396 |
| Fsp3 | 0.048 |
| Mce-18 | 23 |
| Natural product-likeness | -1.927 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |