| General Information | |
|---|---|
| ZINC ID | ZINC000045284611 |
| Molecular Weight (Da) | 513 |
| SMILES | C[C@H](NC(=O)C(C)(C)Nc1cc(-c2ccccc2)on1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C30Cl1N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 145.992 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| LogP | 6.888 |
| Activity (Ki) in nM | 234.423 |
| Polar Surface Area (PSA) | 90.95 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.04410958 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.95 |
| Xlogp3 | 6.77 |
| Wlogp | 6.4 |
| Mlogp | 3.96 |
| Silicos-it log p | 6.46 |
| Consensus log p | 5.51 |
| Esol log s | -7.09 |
| Esol solubility (mg/ml) | 0.0000421 |
| Esol solubility (mol/l) | 8.21E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.49 |
| Ali solubility (mg/ml) | 0.00000167 |
| Ali solubility (mol/l) | 3.26E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.06 |
| Silicos-it solubility (mg/ml) | 4.45E-09 |
| Silicos-it solubility (mol/l) | 8.67E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.65 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.509 |
| Logd | 4.361 |
| Logp | 6.468 |
| F (20%) | 0.011 |
| F (30%) | 0 |
| Mdck | 1.30E-05 |
| Ppb | 1.0007 |
| Vdss | 1.451 |
| Fu | 0.0042 |
| Cyp1a2-inh | 0.758 |
| Cyp1a2-sub | 0.71 |
| Cyp2c19-inh | 0.922 |
| Cyp2c19-sub | 0.1 |
| Cl | 3.392 |
| T12 | 0.02 |
| H-ht | 0.845 |
| Dili | 0.957 |
| Roa | 0.22 |
| Fdamdd | 0.927 |
| Skinsen | 0.044 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.949 |
| Bcf | 1.996 |
| Igc50 | 4.813 |
| Lc50 | 6.532 |
| Lc50dm | 6.271 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.045 |
| Nr-aromatase | 0.259 |
| Nr-er | 0.914 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.578 |
| Sr-are | 0.786 |
| Sr-atad5 | 0.046 |
| Sr-hse | 0.004 |
| Sr-mmp | 0.68 |
| Sr-p53 | 0.081 |
| Vol | 533.078 |
| Dense | 0.961 |
| Flex | 0.346 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.302 |
| Synth | 3.841 |
| Fsp3 | 0.233 |
| Mce-18 | 50 |
| Natural product-likeness | -0.655 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |