| General Information | |
|---|---|
| ZINC ID | ZINC000045285374 |
| Molecular Weight (Da) | 367 |
| SMILES | CC1(C)C(C(=O)c2cn(CCN3CCCCCC3)c3ccccc23)C1(C)C |
| Molecular Formula | C24N2O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.533 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 5.028 |
| Activity (Ki) in nM | 25.704 |
| Polar Surface Area (PSA) | 25.24 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03907144 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.62 |
| Ilogp | 4.01 |
| Xlogp3 | 4.98 |
| Wlogp | 5 |
| Mlogp | 3.72 |
| Silicos-it log p | 5.06 |
| Consensus log p | 4.55 |
| Esol log s | -5.17 |
| Esol solubility (mg/ml) | 0.0025 |
| Esol solubility (mol/l) | 0.00000681 |
| Esol class | Moderately |
| Ali log s | -5.25 |
| Ali solubility (mg/ml) | 0.00207 |
| Ali solubility (mol/l) | 0.00000564 |
| Ali class | Moderately |
| Silicos-it logsw | -6.29 |
| Silicos-it solubility (mg/ml) | 0.000186 |
| Silicos-it solubility (mol/l) | 0.0000005 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.06 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.418 |
| Logd | 4.506 |
| Logp | 5.647 |
| F (20%) | 0.737 |
| F (30%) | 0.918 |
| Mdck | 9.74E-06 |
| Ppb | 0.8914 |
| Vdss | 2.628 |
| Fu | 0.0807 |
| Cyp1a2-inh | 0.079 |
| Cyp1a2-sub | 0.918 |
| Cyp2c19-inh | 0.358 |
| Cyp2c19-sub | 0.935 |
| Cl | 5.071 |
| T12 | 0.012 |
| H-ht | 0.382 |
| Dili | 0.674 |
| Roa | 0.751 |
| Fdamdd | 0.856 |
| Skinsen | 0.532 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.926 |
| Bcf | 1.258 |
| Igc50 | 4.892 |
| Lc50 | 6.285 |
| Lc50dm | 6.07 |
| Nr-ar | 0.106 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.06 |
| Nr-aromatase | 0.898 |
| Nr-er | 0.151 |
| Nr-er-lbd | 0.015 |
| Nr-ppar-gamma | 0.003 |
| Sr-are | 0.421 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.549 |
| Sr-mmp | 0.213 |
| Sr-p53 | 0.019 |
| Vol | 407.036 |
| Dense | 0.9 |
| Flex | 0.238 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.664 |
| Synth | 2.452 |
| Fsp3 | 0.625 |
| Mce-18 | 61.538 |
| Natural product-likeness | -0.782 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |