| General Information | |
|---|---|
| ZINC ID | ZINC000045290152 |
| Molecular Weight (Da) | 460 |
| SMILES | Cc1c(-c2ncn(C(C)C)c2C)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C23Cl3N4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.49 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 7.307 |
| Activity (Ki) in nM | 5.7544 |
| Polar Surface Area (PSA) | 35.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.01 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.22 |
| Ilogp | 4.41 |
| Xlogp3 | 6.69 |
| Wlogp | 7.56 |
| Mlogp | 4.93 |
| Silicos-it log p | 6.49 |
| Consensus log p | 6.02 |
| Esol log s | -7.18 |
| Esol solubility (mg/ml) | 0.0000301 |
| Esol solubility (mol/l) | 6.54E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.24 |
| Ali solubility (mg/ml) | 0.0000263 |
| Ali solubility (mol/l) | 5.73E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.28 |
| Silicos-it solubility (mg/ml) | 0.00000023 |
| Silicos-it solubility (mol/l) | 5.20E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.35 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.245 |
| Logd | 5.122 |
| Logp | 6.57 |
| F (20%) | 0.002 |
| F (30%) | 0.399 |
| Mdck | - |
| Ppb | 98.92% |
| Vdss | 2.684 |
| Fu | 2.21% |
| Cyp1a2-inh | 0.251 |
| Cyp1a2-sub | 0.914 |
| Cyp2c19-inh | 0.885 |
| Cyp2c19-sub | 0.735 |
| Cl | 7.359 |
| T12 | 0.047 |
| H-ht | 0.128 |
| Dili | 0.961 |
| Roa | 0.104 |
| Fdamdd | 0.35 |
| Skinsen | 0.038 |
| Ec | 0.003 |
| Ei | 0.021 |
| Respiratory | 0.039 |
| Bcf | 4.118 |
| Igc50 | 5.212 |
| Lc50 | 6.816 |
| Lc50dm | 6.183 |
| Nr-ar | 0.015 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.913 |
| Nr-aromatase | 0.977 |
| Nr-er | 0.846 |
| Nr-er-lbd | 0.392 |
| Nr-ppar-gamma | 0.006 |
| Sr-are | 0.932 |
| Sr-atad5 | 0.386 |
| Sr-hse | 0.766 |
| Sr-mmp | 0.912 |
| Sr-p53 | 0.96 |
| Vol | 435.394 |
| Dense | 1.052 |
| Flex | 0.182 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.315 |
| Synth | 2.661 |
| Fsp3 | 0.217 |
| Mce-18 | 25 |
| Natural product-likeness | -1.311 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |