| General Information | |
|---|---|
| ZINC ID | ZINC000045302675 |
| Molecular Weight (Da) | 371 |
| SMILES | Cc1ccc(C(=O)N[C@@H]2C(C)(C)[C@@H]3CC[C@@]2(C)C3)cc1CN1CCOCC1 |
| Molecular Formula | C23N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 109.093 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| LogP | 3.754 |
| Activity (Ki) in nM | 19.055 |
| Polar Surface Area (PSA) | 41.57 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.87994921 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.7 |
| Ilogp | 3.97 |
| Xlogp3 | 3.99 |
| Wlogp | 3.24 |
| Mlogp | 3.24 |
| Silicos-it log p | 4.47 |
| Consensus log p | 3.78 |
| Esol log s | -4.49 |
| Esol solubility (mg/ml) | 0.0121 |
| Esol solubility (mol/l) | 0.0000327 |
| Esol class | Moderately |
| Ali log s | -4.56 |
| Ali solubility (mg/ml) | 0.0101 |
| Ali solubility (mol/l) | 0.0000273 |
| Ali class | Moderately |
| Silicos-it logsw | -5.94 |
| Silicos-it solubility (mg/ml) | 0.000427 |
| Silicos-it solubility (mol/l) | 0.00000115 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.73 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.861 |
| Logd | 3.902 |
| Logp | 4.52 |
| F (20%) | 0.009 |
| F (30%) | 0.019 |
| Mdck | 1.36E-05 |
| Ppb | 0.8302 |
| Vdss | 1.696 |
| Fu | 0.2312 |
| Cyp1a2-inh | 0.058 |
| Cyp1a2-sub | 0.453 |
| Cyp2c19-inh | 0.845 |
| Cyp2c19-sub | 0.862 |
| Cl | 7.319 |
| T12 | 0.168 |
| H-ht | 0.18 |
| Dili | 0.081 |
| Roa | 0.805 |
| Fdamdd | 0.799 |
| Skinsen | 0.402 |
| Ec | 0.004 |
| Ei | 0.012 |
| Respiratory | 0.915 |
| Bcf | 0.709 |
| Igc50 | 3.608 |
| Lc50 | 4.628 |
| Lc50dm | 5.366 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.008 |
| Nr-aromatase | 0.527 |
| Nr-er | 0.287 |
| Nr-er-lbd | 0.037 |
| Nr-ppar-gamma | 0.019 |
| Sr-are | 0.109 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.021 |
| Sr-mmp | 0.271 |
| Sr-p53 | 0.061 |
| Vol | 401.166 |
| Dense | 0.923 |
| Flex | 0.238 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.877 |
| Synth | 4.094 |
| Fsp3 | 0.696 |
| Mce-18 | 89.103 |
| Natural product-likeness | -0.334 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |