| General Information | |
|---|---|
| ZINC ID | ZINC000045334580 |
| Molecular Weight (Da) | 369 |
| SMILES | Cc1c[nH]c2c(Nc3cccc(Cl)c3)ncc(C(=O)N3CCCCC3)c12 |
| Molecular Formula | C20Cl1N4O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.44 |
| HBA | 2 |
| HBD | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| LogP | 4.031 |
| Activity (Ki) in nM | 3981.07 |
| Polar Surface Area (PSA) | 61.02 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.05934882 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.3 |
| Ilogp | 2.62 |
| Xlogp3 | 4.15 |
| Wlogp | 4.51 |
| Mlogp | 2.78 |
| Silicos-it log p | 4.3 |
| Consensus log p | 3.67 |
| Esol log s | -4.9 |
| Esol solubility (mg/ml) | 0.0046 |
| Esol solubility (mol/l) | 0.0000125 |
| Esol class | Moderately |
| Ali log s | -5.14 |
| Ali solubility (mg/ml) | 0.00268 |
| Ali solubility (mol/l) | 0.00000726 |
| Ali class | Moderately |
| Silicos-it logsw | -7.1 |
| Silicos-it solubility (mg/ml) | 0.0000291 |
| Silicos-it solubility (mol/l) | 7.89E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.6 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.92 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.329 |
| Logd | 3.866 |
| Logp | 4.685 |
| F (20%) | 0.051 |
| F (30%) | 0.01 |
| Mdck | - |
| Ppb | 98.42% |
| Vdss | 1.482 |
| Fu | 2.60% |
| Cyp1a2-inh | 0.877 |
| Cyp1a2-sub | 0.793 |
| Cyp2c19-inh | 0.961 |
| Cyp2c19-sub | 0.056 |
| Cl | 4.175 |
| T12 | 0.504 |
| H-ht | 0.957 |
| Dili | 0.908 |
| Roa | 0.812 |
| Fdamdd | 0.916 |
| Skinsen | 0.908 |
| Ec | 0.004 |
| Ei | 0.065 |
| Respiratory | 0.923 |
| Bcf | 0.818 |
| Igc50 | 4.232 |
| Lc50 | 5.573 |
| Lc50dm | 5.709 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.98 |
| Nr-aromatase | 0.975 |
| Nr-er | 0.095 |
| Nr-er-lbd | 0.048 |
| Nr-ppar-gamma | 0.235 |
| Sr-are | 0.7 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.704 |
| Sr-mmp | 0.786 |
| Sr-p53 | 0.584 |
| Vol | 367.147 |
| Dense | 1.003 |
| Flex | 0.125 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.695 |
| Synth | 2.898 |
| Fsp3 | 0.3 |
| Mce-18 | 50.077 |
| Natural product-likeness | -1.098 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |