| General Information | |
|---|---|
| ZINC ID | ZINC000045338909 |
| Molecular Weight (Da) | 503 |
| SMILES | O=C(NCc1ccccc1)c1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1Cn1cncn1 |
| Molecular Formula | C26Cl2N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.078 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| LogP | 4.947 |
| Activity (Ki) in nM | 14.1254 |
| Polar Surface Area (PSA) | 77.63 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.198 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 28 |
| Fraction csp3 | 0.08 |
| Ilogp | 4.25 |
| Xlogp3 | 5.59 |
| Wlogp | 5.26 |
| Mlogp | 4.23 |
| Silicos-it log p | 4.58 |
| Consensus log p | 4.78 |
| Esol log s | -6.55 |
| Esol solubility (mg/ml) | 0.000143 |
| Esol solubility (mol/l) | 0.00000028 |
| Esol class | Poorly sol |
| Ali log s | -6.98 |
| Ali solubility (mg/ml) | 0.0000524 |
| Ali solubility (mol/l) | 0.0000001 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.98 |
| Silicos-it solubility (mg/ml) | 0.00000005 |
| Silicos-it solubility (mol/l) | 1.05E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.4 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.287 |
| Logd | 4.405 |
| Logp | 4.722 |
| F (20%) | 0.012 |
| F (30%) | 0.003 |
| Mdck | - |
| Ppb | 97.72% |
| Vdss | 2.563 |
| Fu | 1.11% |
| Cyp1a2-inh | 0.571 |
| Cyp1a2-sub | 0.098 |
| Cyp2c19-inh | 0.953 |
| Cyp2c19-sub | 0.084 |
| Cl | 7.925 |
| T12 | 0.162 |
| H-ht | 0.341 |
| Dili | 0.992 |
| Roa | 0.112 |
| Fdamdd | 0.198 |
| Skinsen | 0.565 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.229 |
| Bcf | 1.65 |
| Igc50 | 4.441 |
| Lc50 | 6.176 |
| Lc50dm | 3.866 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.016 |
| Nr-ahr | 0.919 |
| Nr-aromatase | 0.987 |
| Nr-er | 0.598 |
| Nr-er-lbd | 0.029 |
| Nr-ppar-gamma | 0.496 |
| Sr-are | 0.902 |
| Sr-atad5 | 0.269 |
| Sr-hse | 0.056 |
| Sr-mmp | 0.839 |
| Sr-p53 | 0.611 |
| Vol | 483.752 |
| Dense | 1.038 |
| Flex | 0.276 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.322 |
| Synth | 2.44 |
| Fsp3 | 0.077 |
| Mce-18 | 26 |
| Natural product-likeness | -1.734 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |