| General Information | |
|---|---|
| ZINC ID | ZINC000045338933 |
| Molecular Weight (Da) | 508 |
| SMILES | O=C(NCc1ccc(Cl)cc1)[C@@H]1CC[C@@H](c2ccc(Cl)cc2Cl)N(c2ccc(Cl)cc2)C1 |
| Molecular Formula | C25Cl4N2O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 133.548 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 7.661 |
| Activity (Ki) in nM | 1862.087 |
| Polar Surface Area (PSA) | 32.34 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.119 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.24 |
| Ilogp | 4.58 |
| Xlogp3 | 7.35 |
| Wlogp | 6.72 |
| Mlogp | 5.9 |
| Silicos-it log p | 6.84 |
| Consensus log p | 6.28 |
| Esol log s | -7.64 |
| Esol solubility (mg/ml) | 0.0000116 |
| Esol solubility (mol/l) | 2.28E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.86 |
| Ali solubility (mg/ml) | 0.00000706 |
| Ali solubility (mol/l) | 1.39E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.38 |
| Silicos-it solubility (mg/ml) | 2.14E-08 |
| Silicos-it solubility (mol/l) | 4.21E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.18 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.211 |
| Logd | 4.461 |
| Logp | 6.826 |
| F (20%) | 0.004 |
| F (30%) | 0.612 |
| Mdck | 4.07E-06 |
| Ppb | 1.008 |
| Vdss | 1.553 |
| Fu | 0.0126 |
| Cyp1a2-inh | 0.401 |
| Cyp1a2-sub | 0.914 |
| Cyp2c19-inh | 0.868 |
| Cyp2c19-sub | 0.279 |
| Cl | 4.747 |
| T12 | 0.029 |
| H-ht | 0.527 |
| Dili | 0.899 |
| Roa | 0.568 |
| Fdamdd | 0.871 |
| Skinsen | 0.14 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.195 |
| Bcf | 3.623 |
| Igc50 | 5.262 |
| Lc50 | 6.523 |
| Lc50dm | 6.245 |
| Nr-ar | 0.244 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.155 |
| Nr-aromatase | 0.828 |
| Nr-er | 0.393 |
| Nr-er-lbd | 0.033 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.865 |
| Sr-atad5 | 0.049 |
| Sr-hse | 0.129 |
| Sr-mmp | 0.9 |
| Sr-p53 | 0.842 |
| Vol | 471.994 |
| Dense | 1.072 |
| Flex | 0.24 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.386 |
| Synth | 2.905 |
| Fsp3 | 0.24 |
| Mce-18 | 76.419 |
| Natural product-likeness | -1.156 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |