| General Information | |
|---|---|
| ZINC ID | ZINC000045349218 |
| Molecular Weight (Da) | 427 |
| SMILES | CCCCCOc1c(OC)ccc2cc(C(=O)NCCc3ccccc3)c(Cl)nc12 |
| Molecular Formula | C24Cl1N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.091 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| LogP | 5.757 |
| Activity (Ki) in nM | 501.187 |
| Polar Surface Area (PSA) | 60.45 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.92461621 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.02 |
| Xlogp3 | 6.12 |
| Wlogp | 5.44 |
| Mlogp | 3.46 |
| Silicos-it log p | 6.18 |
| Consensus log p | 5.04 |
| Esol log s | -6.01 |
| Esol solubility (mg/ml) | 4.16E-04 |
| Esol solubility (mol/l) | 9.74E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.17 |
| Ali solubility (mg/ml) | 2.88E-05 |
| Ali solubility (mol/l) | 6.74E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.42 |
| Silicos-it solubility (mg/ml) | 1.64E-07 |
| Silicos-it solubility (mol/l) | 3.84E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.56 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.12 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.064 |
| Logd | 4.187 |
| Logp | 5.019 |
| F (20%) | 0.004 |
| F (30%) | 0.007 |
| Mdck | 1.30E-05 |
| Ppb | 0.9947 |
| Vdss | 0.697 |
| Fu | 0.0093 |
| Cyp1a2-inh | 0.717 |
| Cyp1a2-sub | 0.772 |
| Cyp2c19-inh | 0.962 |
| Cyp2c19-sub | 0.179 |
| Cl | 5.158 |
| T12 | 0.196 |
| H-ht | 0.41 |
| Dili | 0.593 |
| Roa | 0.072 |
| Fdamdd | 0.847 |
| Skinsen | 0.381 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.564 |
| Bcf | 2.352 |
| Igc50 | 4.994 |
| Lc50 | 6.331 |
| Lc50dm | 6.426 |
| Nr-ar | 0.017 |
| Nr-ar-lbd | 0.027 |
| Nr-ahr | 0.916 |
| Nr-aromatase | 0.775 |
| Nr-er | 0.523 |
| Nr-er-lbd | 0.019 |
| Nr-ppar-gamma | 0.964 |
| Sr-are | 0.893 |
| Sr-atad5 | 0.821 |
| Sr-hse | 0.724 |
| Sr-mmp | 0.725 |
| Sr-p53 | 0.873 |
| Vol | 437.838 |
| Dense | 0.973 |
| Flex | 18 |
| Nstereo | 0.611 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.346 |
| Fsp3 | 2.216 |
| Mce-18 | 0.333 |
| Natural product-likeness | 17 |
| Alarm nmr | -0.692 |
| Bms | 2 |
| Chelating | 1 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Rejected |