| General Information | |
|---|---|
| ZINC ID | ZINC000045350145 |
| Molecular Weight (Da) | 496 |
| SMILES | N=C(N)Cc1c(C(=O)NCc2ccc(F)cc2)nn(-c2ccccc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C25Cl2F1N5O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.513 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| LogP | 5.347 |
| Activity (Ki) in nM | 0.7943 |
| Polar Surface Area (PSA) | 96.79 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.046 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.08 |
| Ilogp | 3.9 |
| Xlogp3 | 4.92 |
| Wlogp | 5.66 |
| Mlogp | 4.49 |
| Silicos-it log p | 5.48 |
| Consensus log p | 4.89 |
| Esol log s | -5.99 |
| Esol solubility (mg/ml) | 0.000508 |
| Esol solubility (mol/l) | 0.00000102 |
| Esol class | Moderately |
| Ali log s | -6.69 |
| Ali solubility (mg/ml) | 0.000102 |
| Ali solubility (mol/l) | 0.0000002 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.84 |
| Silicos-it solubility (mg/ml) | 7.14E-08 |
| Silicos-it solubility (mol/l) | 1.44E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.83 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.47 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.239 |
| Logd | 3.429 |
| Logp | 3.844 |
| F (20%) | 0.002 |
| F (30%) | 0.066 |
| Mdck | - |
| Ppb | 97.51% |
| Vdss | 0.686 |
| Fu | 3.21% |
| Cyp1a2-inh | 0.344 |
| Cyp1a2-sub | 0.24 |
| Cyp2c19-inh | 0.91 |
| Cyp2c19-sub | 0.231 |
| Cl | 2.195 |
| T12 | 0.138 |
| H-ht | 0.62 |
| Dili | 0.948 |
| Roa | 0.477 |
| Fdamdd | 0.563 |
| Skinsen | 0.065 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.126 |
| Bcf | 1.569 |
| Igc50 | 4.706 |
| Lc50 | 5.932 |
| Lc50dm | 6.214 |
| Nr-ar | 0.013 |
| Nr-ar-lbd | 0.038 |
| Nr-ahr | 0.579 |
| Nr-aromatase | 0.926 |
| Nr-er | 0.494 |
| Nr-er-lbd | 0.028 |
| Nr-ppar-gamma | 0.897 |
| Sr-are | 0.725 |
| Sr-atad5 | 0.016 |
| Sr-hse | 0.017 |
| Sr-mmp | 0.5 |
| Sr-p53 | 0.632 |
| Vol | 472.72 |
| Dense | 1.047 |
| Flex | 0.32 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.236 |
| Synth | 2.472 |
| Fsp3 | 0.08 |
| Mce-18 | 24 |
| Natural product-likeness | -1.452 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |