| General Information | |
|---|---|
| ZINC ID | ZINC000045351524 |
| Molecular Weight (Da) | 304 |
| SMILES | C[C@H]1CC[C@@H](C)N1c1ccc(-c2cccc3cccnc23)nn1 |
| Molecular Formula | C19N4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 93.569 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| LogP | 4.265 |
| Activity (Ki) in nM | 79.433 |
| Polar Surface Area (PSA) | 41.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.79439503 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.32 |
| Ilogp | 2.85 |
| Xlogp3 | 3.58 |
| Wlogp | 3.69 |
| Mlogp | 3.07 |
| Silicos-it log p | 3.36 |
| Consensus log p | 3.31 |
| Esol log s | -4.37 |
| Esol solubility (mg/ml) | 1.31E-02 |
| Esol solubility (mol/l) | 4.31E-05 |
| Esol class | Moderately |
| Ali log s | -4.15 |
| Ali solubility (mg/ml) | 2.17E-02 |
| Ali solubility (mol/l) | 7.14E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -6.22 |
| Silicos-it solubility (mg/ml) | 1.84E-04 |
| Silicos-it solubility (mol/l) | 6.05E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.61 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.279 |
| Logd | 3.341 |
| Logp | 4.183 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | 2.83E-05 |
| Ppb | 0.9275 |
| Vdss | 1.748 |
| Fu | 0.07 |
| Cyp1a2-inh | 0.935 |
| Cyp1a2-sub | 0.504 |
| Cyp2c19-inh | 0.864 |
| Cyp2c19-sub | 0.629 |
| Cl | 3.433 |
| T12 | 0.106 |
| H-ht | 0.993 |
| Dili | 0.959 |
| Roa | 0.158 |
| Fdamdd | 0.843 |
| Skinsen | 0.78 |
| Ec | 0.004 |
| Ei | 0.04 |
| Respiratory | 0.944 |
| Bcf | 2.46 |
| Igc50 | 4.396 |
| Lc50 | 4.67 |
| Lc50dm | 5.296 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.087 |
| Nr-aromatase | 0.903 |
| Nr-er | 0.518 |
| Nr-er-lbd | 0.207 |
| Nr-ppar-gamma | 0.486 |
| Sr-are | 0.799 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.02 |
| Sr-mmp | 0.5 |
| Sr-p53 | 0.412 |
| Vol | 325.85 |
| Dense | 0.933 |
| Flex | 22 |
| Nstereo | 0.091 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.715 |
| Fsp3 | 3.16 |
| Mce-18 | 0.316 |
| Natural product-likeness | 66.4 |
| Alarm nmr | -1.161 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |