| General Information | |
|---|---|
| ZINC ID | ZINC000045369751 |
| Molecular Weight (Da) | 367 |
| SMILES | CCC(C)(C)C(=O)Nc1cc(C)c(C)c(S(=O)(=O)N2CCCCC2)c1 |
| Molecular Formula | C19N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.619 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| LogP | 3.959 |
| Activity (Ki) in nM | 645.654 |
| Polar Surface Area (PSA) | 74.86 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.76149898 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.63 |
| Ilogp | 3.34 |
| Xlogp3 | 3.58 |
| Wlogp | 4.36 |
| Mlogp | 2.43 |
| Silicos-it log p | 3.16 |
| Consensus log p | 3.38 |
| Esol log s | -4.15 |
| Esol solubility (mg/ml) | 0.026 |
| Esol solubility (mol/l) | 0.0000709 |
| Esol class | Moderately |
| Ali log s | -4.84 |
| Ali solubility (mg/ml) | 0.00532 |
| Ali solubility (mol/l) | 0.0000145 |
| Ali class | Moderately |
| Silicos-it logsw | -5.39 |
| Silicos-it solubility (mg/ml) | 0.00151 |
| Silicos-it solubility (mol/l) | 0.00000411 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.99 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.18 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.895 |
| Logd | 3.993 |
| Logp | 4.56 |
| F (20%) | 0.989 |
| F (30%) | 0.231 |
| Mdck | - |
| Ppb | 97.88% |
| Vdss | 0.888 |
| Fu | 3.93% |
| Cyp1a2-inh | 0.26 |
| Cyp1a2-sub | 0.946 |
| Cyp2c19-inh | 0.797 |
| Cyp2c19-sub | 0.922 |
| Cl | 4.642 |
| T12 | 0.105 |
| H-ht | 0.209 |
| Dili | 0.927 |
| Roa | 0.397 |
| Fdamdd | 0.902 |
| Skinsen | 0.074 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.816 |
| Bcf | 0.791 |
| Igc50 | 3.804 |
| Lc50 | 4.445 |
| Lc50dm | 4.577 |
| Nr-ar | 0.131 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.5 |
| Nr-aromatase | 0.915 |
| Nr-er | 0.24 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.802 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.897 |
| Sr-p53 | 0.037 |
| Vol | 376.395 |
| Dense | 0.973 |
| Flex | 0.4 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.86 |
| Synth | 2.306 |
| Fsp3 | 0.632 |
| Mce-18 | 41.806 |
| Natural product-likeness | -1.723 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |