| General Information | |
|---|---|
| ZINC ID | ZINC000045374528 |
| Molecular Weight (Da) | 381 |
| SMILES | CCC(C)(C)C(=O)Nc1cc(C)c(C)c(S(=O)(=O)N2CCCCCC2)c1 |
| Molecular Formula | C20N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 106.22 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| LogP | 4.416 |
| Activity (Ki) in nM | 8.913 |
| Polar Surface Area (PSA) | 74.86 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.7364788 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.5 |
| Xlogp3 | 3.94 |
| Wlogp | 4.75 |
| Mlogp | 2.66 |
| Silicos-it log p | 3.42 |
| Consensus log p | 3.65 |
| Esol log s | -4.46 |
| Esol solubility (mg/ml) | 0.0133 |
| Esol solubility (mol/l) | 0.000035 |
| Esol class | Moderately |
| Ali log s | -5.21 |
| Ali solubility (mg/ml) | 0.00234 |
| Ali solubility (mol/l) | 0.00000614 |
| Ali class | Moderately |
| Silicos-it logsw | -5.65 |
| Silicos-it solubility (mg/ml) | 0.000844 |
| Silicos-it solubility (mol/l) | 0.00000222 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.82 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.31 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.256 |
| Logd | 4.175 |
| Logp | 5.067 |
| F (20%) | 0.994 |
| F (30%) | 0.512 |
| Mdck | 1.74E-05 |
| Ppb | 0.9815 |
| Vdss | 0.851 |
| Fu | 0.035 |
| Cyp1a2-inh | 0.22 |
| Cyp1a2-sub | 0.95 |
| Cyp2c19-inh | 0.794 |
| Cyp2c19-sub | 0.922 |
| Cl | 4.224 |
| T12 | 0.089 |
| H-ht | 0.199 |
| Dili | 0.926 |
| Roa | 0.388 |
| Fdamdd | 0.907 |
| Skinsen | 0.082 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.838 |
| Bcf | 0.86 |
| Igc50 | 4.214 |
| Lc50 | 4.741 |
| Lc50dm | 4.725 |
| Nr-ar | 0.113 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.502 |
| Nr-aromatase | 0.926 |
| Nr-er | 0.269 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.01 |
| Sr-are | 0.816 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.024 |
| Sr-mmp | 0.91 |
| Sr-p53 | 0.044 |
| Vol | 393.691 |
| Dense | 0.966 |
| Flex | 0.375 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.831 |
| Synth | 2.312 |
| Fsp3 | 0.65 |
| Mce-18 | 42.545 |
| Natural product-likeness | -1.656 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |