| General Information | |
|---|---|
| ZINC ID | ZINC000049035944 |
| Molecular Weight (Da) | 464 |
| SMILES | O=C(NC1CCCCC1)N1CCN([C@@H](c2ccc(F)cc2)c2ccc(Cl)cc2Cl)CC1 |
| Molecular Formula | C24Cl2F1N3O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.016 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 6.84 |
| Activity (Ki) in nM | 158.489 |
| Polar Surface Area (PSA) | 35.58 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.064 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.46 |
| Ilogp | 4.49 |
| Xlogp3 | 5.72 |
| Wlogp | 5.22 |
| Mlogp | 5.06 |
| Silicos-it log p | 5.08 |
| Consensus log p | 5.11 |
| Esol log s | -6.21 |
| Esol solubility (mg/ml) | 0.000284 |
| Esol solubility (mol/l) | 0.00000061 |
| Esol class | Poorly sol |
| Ali log s | -6.23 |
| Ali solubility (mg/ml) | 0.000271 |
| Ali solubility (mol/l) | 0.00000058 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.55 |
| Silicos-it solubility (mg/ml) | 0.000013 |
| Silicos-it solubility (mol/l) | 0.00000002 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.07 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.67 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.084 |
| Logd | 4.539 |
| Logp | 5.611 |
| F (20%) | 0.003 |
| F (30%) | 0.003 |
| Mdck | 9.04E-06 |
| Ppb | 0.9768 |
| Vdss | 1.793 |
| Fu | 0.0127 |
| Cyp1a2-inh | 0.183 |
| Cyp1a2-sub | 0.935 |
| Cyp2c19-inh | 0.855 |
| Cyp2c19-sub | 0.855 |
| Cl | 5.657 |
| T12 | 0.007 |
| H-ht | 0.936 |
| Dili | 0.76 |
| Roa | 0.24 |
| Fdamdd | 0.898 |
| Skinsen | 0.069 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.758 |
| Bcf | 1.387 |
| Igc50 | 4.718 |
| Lc50 | 6.285 |
| Lc50dm | 5.169 |
| Nr-ar | 0.026 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.169 |
| Nr-aromatase | 0.711 |
| Nr-er | 0.313 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.694 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.089 |
| Sr-mmp | 0.699 |
| Sr-p53 | 0.612 |
| Vol | 449.249 |
| Dense | 1.031 |
| Flex | 0.24 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.613 |
| Synth | 2.68 |
| Fsp3 | 0.458 |
| Mce-18 | 78.571 |
| Natural product-likeness | -1.628 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |