| General Information | |
|---|---|
| ZINC ID | ZINC000049047477 |
| Molecular Weight (Da) | 456 |
| SMILES | O=C1CC2(CCSCC2)Oc2nc(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)cc21 |
| Molecular Formula | C24Cl2N1O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.27 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| LogP | 6.115 |
| Activity (Ki) in nM | 7943.282 |
| Polar Surface Area (PSA) | 64.49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.095 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.78 |
| Xlogp3 | 6.21 |
| Wlogp | 6.95 |
| Mlogp | 4.77 |
| Silicos-it log p | 7.24 |
| Consensus log p | 5.79 |
| Esol log s | -6.89 |
| Esol solubility (mg/ml) | 0.0000583 |
| Esol solubility (mol/l) | 0.00000012 |
| Esol class | Poorly sol |
| Ali log s | -7.35 |
| Ali solubility (mg/ml) | 0.0000204 |
| Ali solubility (mol/l) | 4.47E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.83 |
| Silicos-it solubility (mg/ml) | 0.00000006 |
| Silicos-it solubility (mol/l) | 1.49E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.67 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.02 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.135 |
| Logd | 4.317 |
| Logp | 6.299 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | 1.09E-05 |
| Ppb | 1.0037 |
| Vdss | 0.652 |
| Fu | 0.0121 |
| Cyp1a2-inh | 0.78 |
| Cyp1a2-sub | 0.202 |
| Cyp2c19-inh | 0.644 |
| Cyp2c19-sub | 0.06 |
| Cl | 6.859 |
| T12 | 0.014 |
| H-ht | 0.771 |
| Dili | 0.95 |
| Roa | 0.096 |
| Fdamdd | 0.222 |
| Skinsen | 0.04 |
| Ec | 0.003 |
| Ei | 0.022 |
| Respiratory | 0.302 |
| Bcf | 3.468 |
| Igc50 | 5.209 |
| Lc50 | 7.375 |
| Lc50dm | 6.576 |
| Nr-ar | 0.048 |
| Nr-ar-lbd | 0.728 |
| Nr-ahr | 0.955 |
| Nr-aromatase | 0.593 |
| Nr-er | 0.676 |
| Nr-er-lbd | 0.35 |
| Nr-ppar-gamma | 0.105 |
| Sr-are | 0.892 |
| Sr-atad5 | 0.907 |
| Sr-hse | 0.532 |
| Sr-mmp | 0.884 |
| Sr-p53 | 0.945 |
| Vol | 432.022 |
| Dense | 1.053 |
| Flex | 0.067 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.418 |
| Synth | 3.287 |
| Fsp3 | 0.25 |
| Mce-18 | 91.8 |
| Natural product-likeness | -0.568 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |