| General Information | |
|---|---|
| ZINC ID | ZINC000049071015 |
| Molecular Weight (Da) | 506 |
| SMILES | C[C@H](O)C(=O)N[C@@H]1CC(C)(C)Oc2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc21 |
| Molecular Formula | C25Cl3N2O3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.728 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| LogP | 6.095 |
| Activity (Ki) in nM | 2238.721 |
| Polar Surface Area (PSA) | 71.45 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.786 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.28 |
| Ilogp | 3.3 |
| Xlogp3 | 5.97 |
| Wlogp | 6.15 |
| Mlogp | 4.16 |
| Silicos-it log p | 6.6 |
| Consensus log p | 5.24 |
| Esol log s | -6.81 |
| Esol solubility (mg/ml) | 0.0000782 |
| Esol solubility (mol/l) | 0.00000015 |
| Esol class | Poorly sol |
| Ali log s | -7.25 |
| Ali solubility (mg/ml) | 0.0000287 |
| Ali solubility (mol/l) | 5.67E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.69 |
| Silicos-it solubility (mg/ml) | 0.0000001 |
| Silicos-it solubility (mol/l) | 2.06E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.15 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.32 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.664 |
| Logd | 4.615 |
| Logp | 6.17 |
| F (20%) | 0.003 |
| F (30%) | 0.008 |
| Mdck | 8.77E-06 |
| Ppb | 1.004 |
| Vdss | 0.66 |
| Fu | 0.0123 |
| Cyp1a2-inh | 0.625 |
| Cyp1a2-sub | 0.881 |
| Cyp2c19-inh | 0.728 |
| Cyp2c19-sub | 0.07 |
| Cl | 2.808 |
| T12 | 0.038 |
| H-ht | 0.977 |
| Dili | 0.948 |
| Roa | 0.06 |
| Fdamdd | 0.978 |
| Skinsen | 0.034 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.101 |
| Bcf | 3.68 |
| Igc50 | 5.205 |
| Lc50 | 7.413 |
| Lc50dm | 6.838 |
| Nr-ar | 0.118 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.895 |
| Nr-aromatase | 0.871 |
| Nr-er | 0.303 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.292 |
| Sr-are | 0.702 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.089 |
| Sr-mmp | 0.9 |
| Sr-p53 | 0.879 |
| Vol | 474.363 |
| Dense | 1.063 |
| Flex | 0.208 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.389 |
| Synth | 3.665 |
| Fsp3 | 0.28 |
| Mce-18 | 86.062 |
| Natural product-likeness | -0.015 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |