| General Information | |
|---|---|
| ZINC ID | ZINC000049695250 |
| Molecular Weight (Da) | 532 |
| SMILES | COc1ccc(CCNC(=O)c2nn(-c3ccc(Cl)cc3Cl)c(-n3c(C)ccc3C)c2C)cc1Cl |
| Molecular Formula | C26Cl3N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.527 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| LogP | 6.854 |
| Activity (Ki) in nM | 3467.369 |
| Polar Surface Area (PSA) | 61.08 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9641422 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.23 |
| Ilogp | 4.52 |
| Xlogp3 | 7.21 |
| Wlogp | 6.53 |
| Mlogp | 5.02 |
| Silicos-it log p | 6.47 |
| Consensus log p | 5.95 |
| Esol log s | -7.62 |
| Esol solubility (mg/ml) | 0.0000128 |
| Esol solubility (mol/l) | 2.42E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.32 |
| Ali solubility (mg/ml) | 0.00000257 |
| Ali solubility (mol/l) | 4.83E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.08 |
| Silicos-it solubility (mg/ml) | 4.44E-08 |
| Silicos-it solubility (mol/l) | 8.36E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.43 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.383 |
| Logd | 3.807 |
| Logp | 5.844 |
| F (20%) | 0.001 |
| F (30%) | 0.003 |
| Mdck | 8.79E-06 |
| Ppb | 0.986 |
| Vdss | 0.304 |
| Fu | 0.0182 |
| Cyp1a2-inh | 0.181 |
| Cyp1a2-sub | 0.966 |
| Cyp2c19-inh | 0.947 |
| Cyp2c19-sub | 0.912 |
| Cl | 6.678 |
| T12 | 0.225 |
| H-ht | 0.336 |
| Dili | 0.928 |
| Roa | 0.6 |
| Fdamdd | 0.931 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.117 |
| Bcf | 3.467 |
| Igc50 | 5.124 |
| Lc50 | 6.442 |
| Lc50dm | 6.493 |
| Nr-ar | 0.068 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.719 |
| Nr-aromatase | 0.882 |
| Nr-er | 0.667 |
| Nr-er-lbd | 0.037 |
| Nr-ppar-gamma | 0.039 |
| Sr-are | 0.878 |
| Sr-atad5 | 0.812 |
| Sr-hse | 0.02 |
| Sr-mmp | 0.502 |
| Sr-p53 | 0.861 |
| Vol | 502.226 |
| Dense | 1.056 |
| Flex | 0.348 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.295 |
| Synth | 2.629 |
| Fsp3 | 0.231 |
| Mce-18 | 26 |
| Natural product-likeness | -1.414 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |