| General Information | |
|---|---|
| ZINC ID | ZINC000049709180 |
| Molecular Weight (Da) | 622 |
| SMILES | COc1cc(CNC(=O)c2nn(-c3ccc(Cl)cc3Cl)c(-n3c(C)ccc3C)c2C)c(Br)c(OC)c1OC |
| Molecular Formula | C27Br1Cl2N4O4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 151.517 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| LogP | 6.584 |
| Activity (Ki) in nM | 549.541 |
| Polar Surface Area (PSA) | 79.54 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.83720284 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.26 |
| Ilogp | 5.1 |
| Xlogp3 | 6.75 |
| Wlogp | 6.46 |
| Mlogp | 4.25 |
| Silicos-it log p | 6.28 |
| Consensus log p | 5.77 |
| Esol log s | -7.79 |
| Esol solubility (mg/ml) | 0.0000102 |
| Esol solubility (mol/l) | 1.64E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.23 |
| Ali solubility (mg/ml) | 0.0000037 |
| Ali solubility (mol/l) | 5.94E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.05 |
| Silicos-it solubility (mg/ml) | 5.57E-08 |
| Silicos-it solubility (mol/l) | 8.95E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.3 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.94 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.108 |
| Logd | 3.574 |
| Logp | 5.531 |
| F (20%) | 0.001 |
| F (30%) | 0.009 |
| Mdck | 1.09E-05 |
| Ppb | 0.9529 |
| Vdss | 0.349 |
| Fu | 0.0228 |
| Cyp1a2-inh | 0.092 |
| Cyp1a2-sub | 0.943 |
| Cyp2c19-inh | 0.947 |
| Cyp2c19-sub | 0.941 |
| Cl | 5.11 |
| T12 | 0.273 |
| H-ht | 0.188 |
| Dili | 0.906 |
| Roa | 0.327 |
| Fdamdd | 0.859 |
| Skinsen | 0.06 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.172 |
| Bcf | 3.066 |
| Igc50 | 4.766 |
| Lc50 | 6.505 |
| Lc50dm | 6.84 |
| Nr-ar | 0.305 |
| Nr-ar-lbd | 0.042 |
| Nr-ahr | 0.878 |
| Nr-aromatase | 0.819 |
| Nr-er | 0.152 |
| Nr-er-lbd | 0.046 |
| Nr-ppar-gamma | 0.297 |
| Sr-are | 0.806 |
| Sr-atad5 | 0.65 |
| Sr-hse | 0.114 |
| Sr-mmp | 0.588 |
| Sr-p53 | 0.908 |
| Vol | 541.175 |
| Dense | 1.146 |
| Flex | 0.391 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.239 |
| Synth | 2.911 |
| Fsp3 | 0.259 |
| Mce-18 | 28 |
| Natural product-likeness | -1.144 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |