| General Information | |
|---|---|
| ZINC ID | ZINC000049756324 |
| Molecular Weight (Da) | 623 |
| SMILES | C[C@H](O)C1(CNS(=O)(=O)C(F)(F)F)CCN(S(=O)(=O)c2ccc(Cl)cc2S(=O)(=O)c2ccccc2F)CC1 |
| Molecular Formula | C21Cl1F4N2O7S3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.88 |
| HBA | 7 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| LogP | 4.15 |
| Activity (Ki) in nM | 5.129 |
| Polar Surface Area (PSA) | 163.06 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.79858326 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.43 |
| Ilogp | 2.56 |
| Xlogp3 | 3.26 |
| Wlogp | 7.45 |
| Mlogp | 1.92 |
| Silicos-it log p | 2.08 |
| Consensus log p | 3.45 |
| Esol log s | -5.4 |
| Esol solubility (mg/ml) | 2.50E-03 |
| Esol solubility (mol/l) | 4.01E-06 |
| Esol class | Moderately |
| Ali log s | -6.36 |
| Ali solubility (mg/ml) | 2.73E-04 |
| Ali solubility (mol/l) | 4.38E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.17 |
| Silicos-it solubility (mg/ml) | 4.22E-05 |
| Silicos-it solubility (mol/l) | 6.78E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.79 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 2 |
| Muegge number of violations | 3 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.36 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.974 |
| Logd | 2.677 |
| Logp | 3.894 |
| F (20%) | 0.003 |
| F (30%) | 0.006 |
| Mdck | 3.00E-05 |
| Ppb | 0.9738 |
| Vdss | 0.481 |
| Fu | 0.0232 |
| Cyp1a2-inh | 0.185 |
| Cyp1a2-sub | 0.231 |
| Cyp2c19-inh | 0.666 |
| Cyp2c19-sub | 0.729 |
| Cl | 3.193 |
| T12 | 0.025 |
| H-ht | 0.961 |
| Dili | 0.994 |
| Roa | 0.064 |
| Fdamdd | 0.976 |
| Skinsen | 0.029 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.953 |
| Bcf | 0.239 |
| Igc50 | 2.827 |
| Lc50 | 3.657 |
| Lc50dm | 5.15 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.026 |
| Nr-ahr | 0.076 |
| Nr-aromatase | 0.416 |
| Nr-er | 0.12 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.01 |
| Sr-are | 0.692 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.004 |
| Sr-mmp | 0.627 |
| Sr-p53 | 0.006 |
| Vol | 508.818 |
| Dense | 1.223 |
| Flex | 24 |
| Nstereo | 0.375 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 1 |
| Synth | 0.432 |
| Fsp3 | 3.635 |
| Mce-18 | 0.429 |
| Natural product-likeness | 103.333 |
| Alarm nmr | -1.057 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |