| General Information | |
|---|---|
| ZINC ID | ZINC000049756704 |
| Molecular Weight (Da) | 596 |
| SMILES | NC(=O)Cc1c(C(=O)N2CCC(C(=O)O)(c3ccc(F)cn3)CC2)nn(-c2ccccc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C29Cl2F1N5O4 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 151.188 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| LogP | 4.719 |
| Activity (Ki) in nM | 30.1995 |
| Polar Surface Area (PSA) | 131.41 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.121 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.21 |
| Ilogp | 2.99 |
| Xlogp3 | 3.98 |
| Wlogp | 4.71 |
| Mlogp | 3.23 |
| Silicos-it log p | 4.74 |
| Consensus log p | 3.93 |
| Esol log s | -5.93 |
| Esol solubility (mg/ml) | 0.000697 |
| Esol solubility (mol/l) | 0.00000117 |
| Esol class | Moderately |
| Ali log s | -6.44 |
| Ali solubility (mg/ml) | 0.000216 |
| Ali solubility (mol/l) | 0.00000036 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.83 |
| Silicos-it solubility (mg/ml) | 0.00000087 |
| Silicos-it solubility (mol/l) | 1.47E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.11 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.56 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.96 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.776 |
| Logd | 2.582 |
| Logp | 2.956 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 96.37% |
| Vdss | 0.705 |
| Fu | 4.08% |
| Cyp1a2-inh | 0.086 |
| Cyp1a2-sub | 0.115 |
| Cyp2c19-inh | 0.255 |
| Cyp2c19-sub | 0.062 |
| Cl | 0.995 |
| T12 | 0.13 |
| H-ht | 0.494 |
| Dili | 0.973 |
| Roa | 0.902 |
| Fdamdd | 0.91 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.122 |
| Bcf | 0.486 |
| Igc50 | 3.055 |
| Lc50 | 3.968 |
| Lc50dm | 4.126 |
| Nr-ar | 0.146 |
| Nr-ar-lbd | 0.107 |
| Nr-ahr | 0.268 |
| Nr-aromatase | 0.095 |
| Nr-er | 0.543 |
| Nr-er-lbd | 0.367 |
| Nr-ppar-gamma | 0.961 |
| Sr-are | 0.75 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.013 |
| Sr-mmp | 0.227 |
| Sr-p53 | 0.663 |
| Vol | 557.082 |
| Dense | 1.068 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.319 |
| Synth | 2.978 |
| Fsp3 | 0.207 |
| Mce-18 | 73.143 |
| Natural product-likeness | -1.189 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |